Isoproterenol hydrochloride

Catalog Number	ACM51309-1
CAS Number	51-30-9
Structure
Synonyms	3,4-Dihydroxy-alpha-((isopropylamino)methyl)-benzylalcohohydrochloride
Molecular Weight	247.72
InChI	InChI=1S/C11H17NO3.ClH/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8;/h3-5,7,11-15H,6H2,1-2H3;1H
InChI Key	IROWCYIEJAOFOW-UHFFFAOYSA-N
Melting Point	165-175 °C
Purity	98%+
Complexity	187
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	247.0975211
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	5
Monoisotopic Mass	247.0975211
PhysicalState	Solid
Rotatable Bond Count	4
Topological Polar Surface Area	72.7 Ų

Custom Q&A

What is the chemical name of Isoproterenol hydrochloride?

The chemical name of Isoproterenol hydrochloride is asthpul;dl-isadrinehydrochloride;1,[3',4'-DIHYDROXYPHENYL]-2-ISOPROPYLAMINOETHANOL HYDROCHLORIDE.

What is the molecular formula of Isoproterenol hydrochloride?

The molecular formula of Isoproterenol hydrochloride is C11H18ClNO3.

What is the molecular weight of Isoproterenol hydrochloride?

The molecular weight of Isoproterenol hydrochloride is 247.72.

What is the CAS number of Isoproterenol hydrochloride?

The CAS number of Isoproterenol hydrochloride is 949-36-0.

What is the melting point of Isoproterenol hydrochloride?

The melting point of Isoproterenol hydrochloride is 165-175 °C (dec.)(lit.).

What are the hazard codes associated with Isoproterenol hydrochloride?

The hazard code associated with Isoproterenol hydrochloride is Xi.

What are the risk statements for Isoproterenol hydrochloride?

The risk statements for Isoproterenol hydrochloride are 36/37/38.

What are the safety statements for Isoproterenol hydrochloride?

The safety statements for Isoproterenol hydrochloride are 26-36.

What is the WGK classification of Isoproterenol hydrochloride in Germany?

The WGK classification of Isoproterenol hydrochloride in Germany is 2.

What is the usage of Isoproterenol hydrochloride?

Isoproterenol hydrochloride is primarily used as a member of catechols.

※ Please kindly note that our products are for research use only.