Isorauhimbine

Catalog Number	ACM483090
CAS Number	483-09-0
Synonyms	(3β,20α)-17α-Hydroxyyohimban-16β-carboxylic acid methyl ester
Molecular Weight	354.4
InChI	InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/t12-,15+,17-,18+,19+/m1/s1
InChI Key	BLGXFZZNTVWLAY-RIEHRDFOSA-N
Purity	95%+
Complexity	555
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	354.1943427
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	COC(=O)[C@@H]1[C@H](CC[C@H]2[C@@H]1C[C@@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O
Monoisotopic Mass	354.1943427
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	65.6 Ų

Custom Q&A

What is the chemical name of Isorauhimbine?

The chemical name of Isorauhimbine is (3β,20α)-17α-Hydroxyyohimban-16β-carboxylic acid methyl ester.

What are some synonyms of Isorauhimbine?

Some synonyms of Isorauhimbine include 3-Epi-α-yohimbine, epi-3alpha-Yohimbine, 3-Epiisoyohimbine, and Yohimban-16-carboxylic acid, 17-hydroxy-, methyl ester.

What is the CAS number of Isorauhimbine?

The CAS number of Isorauhimbine is 483-09-0.

What is the molecular formula of Isorauhimbine?

The molecular formula of Isorauhimbine is C21H26N2O3.

What is the molecular weight of Isorauhimbine?

The molecular weight of Isorauhimbine is 354.44.

What is the melting point of Isorauhimbine?

The melting point of Isorauhimbine is 225-227 °C.

What is the predicted boiling point of Isorauhimbine?

The predicted boiling point of Isorauhimbine is 543.0±50.0 °C.

What is the predicted density of Isorauhimbine?

The predicted density of Isorauhimbine is 1.31±0.1 g/cm3.

What is the predicted pka value of Isorauhimbine?

The predicted pka value of Isorauhimbine is 14.39±0.40.

How can Isorauhimbine be used?

Isorauhimbine can be used as an inhibitor of aldose reductase, which is a potent drug target for diabetes and its complications.

※ Please kindly note that our products are for research use only.