Isosparteine

Isosparteine

Inquiry
Catalog Number ACM24915046
CAS Number 24915-04-6
Structure
Synonyms (7S,7aβ,14aβ)-Dodecahydro-7α,14α-methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine
IUPAC Name (6α)-Sparteine
Molecular Weight 234.38
Molecular Formula C15H26N2
InChI InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15-/m0/s1
InChI Key SLRCCWJSBJZJBV-AJNGGQMLSA-N
Boiling Point 340.9ºC at 760mmHg
Flash Point 148.3ºC
Purity 95%+
Density 1.08g/cm³
Complexity 263
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 234.209598838
Heavy Atom Count 17
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 0
Isomeric SMILES C1CCN2C[C@@H]3C[C@H]([C@@H]2C1)CN4[C@H]3CCCC4
Monoisotopic Mass 234.209598838
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 6.5 Ų
Custom Q&A

What is the chemical formula for Isosparteine?

The chemical formula for Isosparteine is C15H26N2.

What is the molar mass of Isosparteine?

The molar mass of Isosparteine is 234.38 g/mol.

What is the optical rotation of Isosparteine?

Isosparteine has an optical rotation of alpha D32 -15.3°.

In what solvents is Isosparteine soluble?

Isosparteine is soluble in chloroform, dichloromethane, ethyl acetate, DMSO, acetone, etc.

What is the boiling point range of Isosparteine?

The boiling point range of Isosparteine is between 100-110°C.

What are some synonyms for Isosparteine?

Some synonyms for Isosparteine are β-Isosparteine, b-Isosparteine, and 7,14-Methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine, dodecahydro-, (7S,7aS,14S,14aS)-.

What is the CAS number for Isosparteine?

The CAS number for Isosparteine is 24915-04-6.

What is the specific rotation of Isosparteine at a concentration of 2.3 in absolute alcohol?

The specific rotation of Isosparteine at a concentration of 2.3 in absolute alcohol is -15.3°.

How does Isosparteine typically appear?

Isosparteine typically appears in powder form.

※ Please kindly note that our products are for research use only.