Khasianine

Catalog Number	ACM32449982
CAS Number	32449-98-2
Structure
Synonyms	β2-Solamargine
Molecular Weight	721.9
InChI	InChI=1S/C39H63NO11/c1-18-8-13-39(40-16-18)19(2)28-26(51-39)15-25-23-7-6-21-14-22(9-11-37(21,4)24(23)10-12-38(25,28)5)48-36-33(46)31(44)34(27(17-41)49-36)50-35-32(45)30(43)29(42)20(3)47-35/h6,18-20,22-36,40-46H,7-17H2,1-5H3/t18-,19+,20+,22+,23-,24+,25+,26+,27-,28+,29+,30-,31-,32-,33-,34-,35+,36-,37+,38+,39-/m1/s1
InChI Key	KRQDMAXNTWLTDZ-HCTICQNOSA-N
Purity	95%+
Complexity	1320
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	21
Exact Mass	721.44011183
Heavy Atom Count	51
Hydrogen Bond Acceptor Count	12
Hydrogen Bond Donor Count	7
Isomeric SMILES	C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O)C)C)C)NC1
Monoisotopic Mass	721.44011183
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	180 Ų

Custom Q&A

What is the chemical formula (MF) of khasianine?

The chemical formula of khasianine is C39H63NO11.

What is the molecular weight (MW) of khasianine?

The molecular weight of khasianine is 721.93.

What are some synonyms of khasianine?

Some synonyms of khasianine include KHASIANINE, Β2-SOLAMARGINE, and beta2-Solamargine.

What is the boiling point of khasianine?

The predicted boiling point of khasianine is 847.4±65.0 °C.

How is khasianine stored?

Khasianine is stored in a hygroscopic environment, at -20°C in a freezer, under an inert atmosphere.

What is the solubility of khasianine in DMSO?

Khasianine is slightly soluble in DMSO.

Where is khasianine obtained from?

Khasianine is obtained from black nightshade (Solanum Nigrum L.).

What color is khasianine?

Khasianine is pale beige in color.

What is the pka value of khasianine?

The predicted pka value of khasianine is 12.78±0.70.

What is the stability of khasianine?

Khasianine is hygroscopic in nature.

※ Please kindly note that our products are for research use only.