Kifunensine

Catalog Number	ACM109944152
CAS Number	109944-15-2
Structure
Synonyms	(5R,8aS)-1,5,6,7,8,8a-Hexahydro-6β,7α,8α-trihydroxy-5α-(hydroxymethyl)imidazo[1,2-a]pyridine-2,3-dione
Molecular Weight	232.19
Molecular Formula	C8H12N2O6
InChI	InChI=1S/C8H12N2O6/c11-1-2-3(12)4(13)5(14)6-9-7(15)8(16)10(2)6/h2-6,11-14H,1H2,(H,9,15)/t2-,3-,4+,5+,6+/m1/s1
InChI Key	OIURYJWYVIAOCW-PQMKYFCFSA-N
Melting Point	>280 °C
Purity	95%+
Complexity	335
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	232.06953611
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	5
Isomeric SMILES	C([C@@H]1[C@H]([C@@H]([C@@H]([C@@H]2N1C(=O)C(=O)N2)O)O)O)O
Monoisotopic Mass	232.06953611
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	130 Ų

Custom Q&A

What is the chemical formula of Kifunensine?

The chemical formula of Kifunensine is C8H12N2O6.

What is the molecular weight of Kifunensine?

The molecular weight of Kifunensine is 232.19 g/mol.

What is the solubility of Kifunensine in water?

Kifunensine is soluble to 5 mM in water with sonication.

What is the primary use of Kifunensine?

Kifunensine is a potent inhibitor of glycoprotein processing enzymes, specifically mannosidase I.

What is the effect of Kifunensine on mannosidase II and the endoplasmic reticulum α-mannosidase?

Kifunensine does not affect mannosidase II or the endoplasmic reticulum α-mannosidase.

What is the storage recommendation for Kifunensine?

Kifunensine should be stored at -20°C.

What is the biological activity of Kifunensine?

Kifunensine is an inhibitor of class I α-mannosidases, inhibiting glycoprotein processing.

How does Kifunensine improve the maturation of misfolded proteins?

Kifunensine inhibits endoplasmic reticulum α-1,2-mannosidase I activity, leading to the rescue of misfolded proteins.

What is the safety classification of Kifunensine in Germany?

Kifunensine is classified as WGK Germany 3.

How does Kifunensine impact limb girdle muscular dystrophy type 2D patients?

Kifunensine offers a new pharmacological approach for patients with limb girdle muscular dystrophy type 2D by rescuing mutations affecting a-sarcoglycan trafficking.

※ Please kindly note that our products are for research use only.