Kipukasin D

Kipukasin D

Inquiry
Catalog Number ACM948574003
CAS Number 948574-00-3
Molecular Weight 422.39
Molecular Formula C19H22N2O9
Canonical SMILES OC[C@@H]1[C@@H](OC(C2=C(C)C=C(OC)C=C2OC)=O)[C@@H](O)[C@H](N3C(NC(C=C3)=O)=O)O1
Custom Q&A

What is the chemical formula of pergolide?

The chemical formula of pergolide is C19H26N2S.

What is the therapeutic function of pergolide?

Pergolide is a dopamine agonist.

What are the safety precautions associated with pergolide?

RIDADR UN 1544 6.1/PG II, RTECS KE6344964, HazardClass 6.1, PackingGroup II.

What is the primary clinical use of pergolide in veterinary medicine?

The primary use for pergolide in veterinary medicine is in the treatment of horses for pituitary pars intermedia dysfunction (PPID).

How is pergolide metabolized in the body?

Pergolide is extensively hepatically metabolized, with at least 10 metabolites detected in the urine and feces.

What is the originator of pergolide?

Celance and Eli Lilly are the originators of pergolide.

Why was pergolide withdrawn from the markets in the US and Canada in 2007?

Pergolide was withdrawn from the markets in the US and Canada in 2007 due to an increased risk of cardiac valve dysfunction.

What is the molecular weight of pergolide?

The molecular weight of pergolide is 314.49 g/mol.

What is the boiling point of pergolide?

The boiling point of pergolide is predicted to be 491.3 ± 35.0 °C.

How is pergolide primarily eliminated from the body?

Elimination of the drug is primarily renal, with a half-life of approximately 27 hours.

※ Please kindly note that our products are for research use only.