Koumine

Koumine

Inquiry
Catalog Number ACM1358765
CAS Number 1358-76-5
Structure
Molecular Weight 306.4
InChI InChI=1S/C20H22N2O/c1-3-19-11-22(2)16-9-20(19)13-6-4-5-7-15(13)21-18(20)17-8-14(19)12(16)10-23-17/h3-7,12,14,16-17H,1,8-11H2,2H3/t12-,14+,16-,17+,19-,20+/m0/s1
InChI Key VTLYEMHGPMGUOT-FXWNUWCSSA-N
Melting Point 168 °C
Purity 98%+
Complexity 615
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 6
Exact Mass 306.17321333
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Isomeric SMILES CN1C[C@]2([C@@H]3C[C@@H]4C5=NC6=CC=CC=C6[C@]52C[C@H]1[C@H]3CO4)C=C
Monoisotopic Mass 306.17321333
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 24.8 Ų
Custom Q&A

What is the chemical name for koumine?

The chemical name for koumine is (3R,7alpha,20alpha)-1,2,18,19-Tetradehydro-3,17-epoxy-7,20(2H,19H)cyclovobasan.

What is the molecular formula of koumine?

The molecular formula of koumine is C20H22N2O.

What is the molecular weight of koumine?

The molecular weight of koumine is 306.4.

What is the melting point of koumine?

The melting point of koumine is 168℃.

What is the boiling point of koumine?

The boiling point of koumine is 436.5±45.0 °C (Predicted).

What are the storage conditions recommended for koumine?

The recommended storage temperature for koumine is 2-8°C.

What is the color of koumine?

Koumine is yellow-brown in color.

Where does koumine occur naturally?

Koumine is an alkaloid isolated from Gelsemium elegans Benth.

What are the uses of koumine?

Koumine is known to attenuate the lipopolysaccharide-stimulated inflammation in RAW264.7 macrophages.

Which study is referenced for information on koumine's isolation and properties?

The studies referenced for information on koumine's isolation and properties are Chou, Pak, Hou., Chin. 1. Physiol., 5, 345 (1931) and Chi, Kao, Huang., 1. Amer. Chem. Soc., 60, 1723 (1938).

※ Please kindly note that our products are for research use only.