Kukoamine B

Kukoamine B

Inquiry
Catalog Number ACM164991677
CAS Number 164991-67-7
Structure
Synonyms Dihydroxybenzenepropanamide
Molecular Weight 530.7
InChI InChI=1S/C28H42N4O6/c29-13-3-18-32(28(38)12-8-22-6-10-24(34)26(36)20-22)17-2-1-14-30-15-4-16-31-27(37)11-7-21-5-9-23(33)25(35)19-21/h5-6,9-10,19-20,30,33-36H,1-4,7-8,11-18,29H2,(H,31,37)
InChI Key IWRAOCFRRTWUDF-UHFFFAOYSA-N
Purity 95%+
Complexity 669
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 530.31043507
Heavy Atom Count 38
Hydrogen Bond Acceptor Count 8
Hydrogen Bond Donor Count 7
Monoisotopic Mass 530.31043507
PhysicalState Powder
Rotatable Bond Count 18
Topological Polar Surface Area 168 Ų
Custom Q&A

What is the chemical formula of KukoaMine B?

The chemical formula of KukoaMine B is C28H42N4O6.

What is the molecular weight of KukoaMine B?

The molecular weight of KukoaMine B is 530.66 g/mol.

What is the boiling point of KukoaMine B?

The predicted boiling point of KukoaMine B is 844.3±65.0 °C.

What is the density of KukoaMine B at 20 ºC and 760 Torr?

The density of KukoaMine B is 1.232±0.06 g/cm3 at 20 ºC and 760 Torr.

What are the solubility values of KukoaMine B in various solvents?

KukoaMine B is soluble in DMF, DMSO, Ethanol, PBS (pH 7.2), and Water at different concentrations.

What is the form of KukoaMine B?

KukoaMine B is in the form of a crystalline solid.

What is the pKa of KukoaMine B?

The predicted pKa of KukoaMine B is 9.78±0.10.

What are the uses of KukoaMine B?

KukoaMine B is used for protection against NMDA-induced neurotoxicity and inhibiting inflammatory response in the livers of septic mice.

What is the ChEBI definition of KukoaMine B?

According to ChEBI, KukoaMine B is an amine alkaloid.

How is KukoaMine B described in terms of an amide?

KukoaMine B is described as an amide alkaloid.

※ Please kindly note that our products are for research use only.