Laetanine

Laetanine

Inquiry
Catalog Number ACM72361672
CAS Number 72361-67-2
Molecular Weight 313.3
InChI InChI=1S/C18H19NO4/c1-22-15-7-10-5-12-16-9(3-4-19-12)6-14(21)18(23-2)17(16)11(10)8-13(15)20/h6-8,12,19-21H,3-5H2,1-2H3
InChI Key URQAEFLEDPPPFX-UHFFFAOYSA-N
Purity 90%+
Complexity 433
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 313.13140809
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 3
Monoisotopic Mass 313.13140809
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 71 Ų
Custom Q&A

What is the chemical formula for laetanine?

The chemical formula for laetanine is C18H19NO4.

What is the molecular weight of laetanine?

The molecular weight of laetanine is 313.35 g/mol.

What is the boiling point of laetanine?

The boiling point of laetanine is predicted to be 551.0±50.0 °C.

What is the density of laetanine?

The density of laetanine is predicted to be 1.313±0.06 g/cm3.

What is the storage temperature recommended for laetanine?

The recommended storage temperature for laetanine is -20°C.

In what solvent is laetanine soluble?

Laetanine is soluble in DMSO.

From which plant is laetanine isolated?

Laetanine is an alkaloid isolated from Litsea laeta.

What are the physical characteristics of laetanine when crystallized from EtOH?

Laetanine yields colorless needles when crystallized from EtOH.

What is the specific rotation of laetanine in MeOH?

The specific rotation of laetanine in MeOH is [α]D +105° (c 0.4).

What is the predicted pKa value of laetanine?

The predicted pKa value of laetanine is 9.80±0.20.

※ Please kindly note that our products are for research use only.