Lasiocarpine

Catalog Number	ACM303344-1
CAS Number	303-34-4
Description	Lasiocarpine is a n-oxide that has been shown to have genotoxic effects in a model system. This drug induces cell lysis and is toxic to humans, causing liver lesions. Lasiocarpine is metabolized by cyp3a4, which is found in the liver. Retrorsine, which is also metabolized by cyp3a4, has been shown to be carcinogenic in experimental models and humans. The potency of lasicarpine as an anticancer agent is low because it lacks the ability to cross the blood brain barrier.
Molecular Weight	411.49 g/mol
Molecular Formula	C21H33NO7
Canonical SMILES	C/C=C(/C)\C(=O)O[C@H]1CCN2[C@@H]1C(=CC2)COC(=O)[C@@]([C@H](C)OC)(C(C)(C)O)O
Storage	store at 2℃-8℃, close container well
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939799090 - China: 2939799099

Custom Q&A

What is the chemical formula of lasiocarpine?

The chemical formula of lasiocarpine is C21H33NO7.

What is the molecular weight of lasiocarpine?

The molecular weight of lasiocarpine is 411.49 g/mol.

What is the melting point of lasiocarpine?

The melting point of lasiocarpine is 96.5-97.0℃.

How stable is lasiocarpine?

Lasilocarpine is stable, but it is readily hydrolyzed in basic solution and readily oxidized by oxidizing agents. It also reacts slowly with atmospheric oxygen.

What are the hazardous classifications of lasiocarpine?

RIDADR: 1544, HazardClass: 6.1(b), PackingGroup: III

What are the chemical properties of lasiocarpine?

Lasiodcirpine is a colourless to beige crystalline solid.

What is the main usage of lasiocarpine?

Lasiocarpine is a hepatotoxic and carcinogenic food contaminant.

How does lasiocarpine react with oxidizing agents?

Lasiocarpine reacts readily with oxidizing agents.

What are the health hazards associated with lasiocarpine?

When heated to decomposition, lasiocarpine emits toxic fumes of nitrogen oxides.

What is the general description of lasiocarpine?

Lasiocarpine is described as colorless plates or beige crystalline solid.

※ Please kindly note that our products are for research use only.