Latifoline

Catalog Number	ACM6029863
CAS Number	6029-86-3
Synonyms	(2R)-Tetrahydro-3β-hydroxy-2α,4α-dimethyl-5-oxofuran-3-carboxylic acid [[(7R,7aR)-5,6,7,7a-tetrahydro-7-[(Z)-2-methyl-2-butenoyloxy]-3H-pyrrolizin]-1-yl]methyl ester
Molecular Weight	393.4
InChI	InChI=1S/C20H27NO7/c1-5-11(2)17(22)28-15-7-9-21-8-6-14(16(15)21)10-26-19(24)20(25)12(3)18(23)27-13(20)4/h5-6,12-13,15-16,25H,7-10H2,1-4H3/b11-5-/t12-,13-,15-,16-,20+/m1/s1
InChI Key	LZKFLVDOCDILCY-CYSCPGKSSA-N
Melting Point	162-166 °C
Purity	95%+
Complexity	743
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	393.1787522
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(/C)\C(=O)O[C@@H]1CCN2[C@@H]1C(=CC2)COC(=O)[C@@]3([C@@H](C(=O)O[C@@H]3C)C)O
Monoisotopic Mass	393.1787522
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	102 Ų

Custom Q&A

What is the chemical formula of Latifoline?

The chemical formula of Latifoline is C20H27NO7.

What is the molecular weight of Latifoline?

The molecular weight of Latifoline is 393.43.

What is the CAS number of Latifoline?

The CAS number of Latifoline is 6029-86-3.

What is the melting point of Latifoline?

The melting point of Latifoline is 162-6°C or 129°C.

Where is Latifoline extracted from?

Latifoline is extracted from the bark of Funturnia latifolia Stapf.

What is the natural optical rotation of Latifoline?

The natural optical rotation of Latifoline is laevorotatory with [α]D- 4.0° (c 0.8, CHCl3).

How is the synthetic optically inactive form of Latifoline different from the natural base?

The synthetic optically inactive form of Latifoline has a melting point of 170.5-171.5°C.

What is the chemical structure of Latifoline?

The chemical structure of Latifoline has been shown from spectroscopic evidence to be 5-conanen-3~-01.

What type of compound is Latifoline according to ChEBI?

Latifoline is classified as a carbonyl compound according to ChEBI.

※ Please kindly note that our products are for research use only.