Latrunculin b

Catalog Number	ACM76343947
CAS Number	76343-94-7
Description	Latrunculin B, an antimicrobial marine alkaloid, is an actin polymerization inhibitor.
Synonyms	(4R)-[(1R,4Z,8Z,10S,13R,15R)-15-Hydroxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-2-thiazolidinone
IUPAC Name	(4R)-4-[(1R,4Z,8Z,10S,13R,15R)-15-Hydroxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-1,3-thiazolidin-2-one
Molecular Weight	395.5
Molecular Formula	C20H29NO5S
Canonical SMILES	CC1CCC2CC(CC(O2)(C3CSC(=O)N3)O)OC(=O)C=C(CCC=C1)C
InChI	InChI=1S/C20H29NO5S/c1-13-5-3-4-6-14(2)9-18(22)25-16-10-15(8-7-13)26-20(24,11-16)17-12-27-19(23)21-17/h3,5,9,13,15-17,24H,4,6-8,10-12H2,1-2H3,(H,21,23)/b5-3-,14-9-/t13-,15-,16-,17+,20-/m1/s1
InChI Key	NSHPHXHGRHSMIK-JRIKCGFMSA-N
Purity	95%+
Solubility	Soluble in DMSO
Appearance	Oil
Storage	Pure form-20°C, 3 years; In solvent-80°C, 6 months; -20°C, 1 month.
Complexity	634
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	395.1766442
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@H]/1CC[C@@H]2C[C@H](C[C@@](O2)([C@@H]3CSC(=O)N3)O)OC(=O)/C=C(\CC/C=C1)/C
Monoisotopic Mass	395.1766442
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	110 Ų

Custom Q&A

What is the chemical formula of Latrunculin B?

The chemical formula of Latrunculin B is C20H29NO5S.

How is Latrunculin B stored?

Latrunculin B is stored at -20°C.

What is the solubility of Latrunculin B?

Latrunculin B is soluble in DMSO.

What is the color of Latrunculin B?

The color of Latrunculin B is light yellow.

What is the primary target of Latrunculin B?

The primary target of Latrunculin B is actin polymerization.

How long is Latrunculin B stable for after purchase?

Latrunculin B is stable for 1 year from the date of purchase as supplied.

What is the molecular weight of Latrunculin B?

The molecular weight of Latrunculin B is 395.51.

What is the primary source of Latrunculin B?

Latrunculin B is obtained from the Red Sea sponge Latrunculia magnifica.

How does Latrunculin B affect microfilament mediated processes?

Latrunculin B significantly disrupts microfilament mediated processes.

※ Please kindly note that our products are for research use only.