Laurocapram

Catalog Number	ACM59227893-1
CAS Number	59227-89-3
Synonyms	N-Dodecylcaprolactam
IUPAC Name	1-Dodecylazepan-2-one
Molecular Weight	281.5
Molecular Formula	C18H35NO
Canonical SMILES	CCCCCCCCCCCCN1CCCCCC1=O
InChI	InChI=1S/C18H35NO/c1-2-3-4-5-6-7-8-9-10-13-16-19-17-14-11-12-15-18(19)20/h2-17H2,1H3
InChI Key	AXTGDCSMTYGJND-UHFFFAOYSA-N
Purity	98%+(HPLC)
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	240
Exact Mass	281.271864740
Heavy Atom Count	20
Monoisotopic Mass	281.271864740
Topological Polar Surface Area	20.3Ų

Custom Q&A

What is the chemical formula of Laurocapram?

The chemical formula of Laurocapram is C18H35NO.

What is the boiling point of Laurocapram?

The boiling point of Laurocapram is approximately 160°C.

What is the solubility of Laurocapram in chloroform, ethanol, and methanol?

Laurocapram is slightly soluble in chloroform, ethanol, and methanol.

What is the color of Laurocapram?

Laurocapram is colorless.

What is the main application of Laurocapram as?

Laurocapram is used as a penetration enhancer in cosmetic preparations and personal-care products.

What are some synonyms for Laurocapram?

Some synonyms for Laurocapram include Azone, Laurocapram, and Dodecylazacycloheptan-2-one.

What is the safety statement associated with Laurocapram?

The safety statement for Laurocapram is 24/25.

How does Laurocapram enhance drug absorption through the skin?

Laurocapram promotes the hydrophilic and lipophilic drug product activity or cosmetic nutrients to penetrate into the skin, reducing the drug remain time in the stratum corneum and enhancing drug efficacy.

What is the LD50 value for rats and mice when exposed to Laurocapram?

The LD50 value for rats and mice when exposed to Laurocapram is 8 g/kg when administered intravenously or intraperitoneally.

How is Laurocapram used in the pharmaceutical industry?

Laurocapram is used as a pharmaceutic aid (excipient) in the pharmaceutical industry.

※ Please kindly note that our products are for research use only.