Laurolitsine

Catalog Number	ACM5890186
CAS Number	5890-18-6
Structure
Synonyms	1,10-Dimethoxy-6aα-noraporphine-2,9-diol
Molecular Weight	313.3
InChI	InChI=1S/C18H19NO4/c1-22-15-8-11-10(7-13(15)20)5-12-16-9(3-4-19-12)6-14(21)18(23-2)17(11)16/h6-8,12,19-21H,3-5H2,1-2H3/t12-/m0/s1
InChI Key	KYVJVURXKAZJRK-LBPRGKRZSA-N
Melting Point	138-140 ºC
Purity	95%+
Complexity	433
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	313.13140809
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	3
Isomeric SMILES	COC1=C(C=C2C[C@H]3C4=C(C2=C1)C(=C(C=C4CCN3)O)OC)O
Monoisotopic Mass	313.13140809
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	71 Ų

Custom Q&A

What is the chemical formula of Laurolitsine?

The chemical formula of Laurolitsine is C18H19NO4.

What are the synonyms of Laurolitsine?

The synonyms of Laurolitsine include Norboldine, Aids161652, and Laurolistine.

What is the melting point of Laurolitsine?

The melting point of Laurolitsine is 138-140 ºC.

In which solvents is Laurolitsine soluble?

Laurolitsine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

From which plant species can Laurolitsine be obtained?

Laurolitsine can be obtained from Litsea japonica and Neolitsea sericea.

What is the refractive index of Laurolitsine?

The estimated refractive index of Laurolitsine is 1.5100.

What is the predicted pka of Laurolitsine?

The predicted pka of Laurolitsine is 9.81±0.20.

What is the boiling point of Laurolitsine?

The boiling point of Laurolitsine is estimated to be 453.15°C.

What is the usage of Laurolitsine?

Laurolitsine is an alkaloid extracted from Polyalthia longifolia var. pendula.

What inhibitory activity does Laurolitsine exhibit?

Laurolitsine exhibits inhibitory activity against HIV-1 integrase.

※ Please kindly note that our products are for research use only.