Lemannine

Catalog Number	ACM58480549
CAS Number	58480-54-9
Synonyms	12,13-Didehydromatridin-15-one
Molecular Weight	246.35
InChI	InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,6,11-13,15H,2-5,7-10H2/t11-,12+,13+,15-/m0/s1
InChI Key	WUVYENIUARJBNM-JLNYLFASSA-N
Purity	90%+
Complexity	392
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	246.17321333
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1C[C@H]2CN3[C@H](C=CCC3=O)[C@@H]4[C@H]2N(C1)CCC4
Monoisotopic Mass	246.17321333
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	23.6 Ų

Custom Q&A

What is the chemical formula for Lemannine?

The chemical formula for Lemannine is C15H22N2O.

What are the synonyms for Lemannine?

The synonyms for Lemannine are Lemannine and 12,13-didehydromatridin-15-one.

What is the molecular weight of Lemannine?

The molecular weight of Lemannine is 246.34798 g/mol.

What is the CAS number for Lemannine?

The CAS number for Lemannine is 58480-54-9.

What are the storage conditions recommended for Lemannine?

Lemannine should be stored at 4°C and protected from light.

What are the significant activities of Lemannine?

Lemannine shows significant anti-hepatitis B virus (HBV) activities.

What are some other activities Lemannine is used for?

Lemannine is also used to prepare benzenesulfonyl sophocarpinols with antienteroviral activities.

How is Lemannine prepared?

Lemannine can be prepared to prepare benzenesulfonyl sophocarpinols with antienteroviral activities.

What is the chemical name of Lemannine?

The chemical name of Lemannine is (7aS,13aR,13bS,13cS)-2,3,6,7,7a,8,11,13a,13b,13c-Decahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one.

What are some potential benefits of using Lemannine?

Some potential benefits of using Lemannine include its anti-hepatitis B virus activities and its ability to prepare compounds with antienteroviral activities.

※ Please kindly note that our products are for research use only.