Lirinidine

Catalog Number	ACM54383287
CAS Number	54383-28-7
Synonyms	(6aS)-5,6,6aα,7-Tetrahydro-2-methoxy-6-methyl-4H-dibenzo[de,g]quinolin-1-ol
Molecular Weight	281.3
InChI	InChI=1S/C18H19NO2/c1-19-8-7-12-10-15(21-2)18(20)17-13-6-4-3-5-11(13)9-14(19)16(12)17/h3-6,10,14,20H,7-9H2,1-2H3/t14-/m0/s1
InChI Key	YXVXMURDCBMPRH-AWEZNQCLSA-N
Purity	95%+
Complexity	387
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	281.141578849
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC=CC=C43)O)OC
Monoisotopic Mass	281.141578849
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	32.7 Ų

Custom Q&A

What is lirinidine's chemical formula?

The chemical formula of lirinidine is C18H19NO2.

What is lirinidine's molecular weight?

The molecular weight of lirinidine is 281.35 g/mol.

What is lirinidine's boiling point?

The boiling point of lirinidine is predicted to be 451.4±45.0 °C.

What is lirinidine's density?

The density of lirinidine is predicted to be 1.216±0.06 g/cm3.

What is the pka value of lirinidine?

The pka value of lirinidine is predicted to be 9.90±0.20.

What are some synonyms of lirinidine?

Some synonyms of lirinidine include 5,6,6a,7-tetrahydro-2-methoxy-6-methyl-4H-dibenzo[de,g]quinolin-1-ol and (+)-Lirinidine.

What are some potential uses of lirinidine?

Lirinidine has been noted to have potential uses as an anticancer agent, inhibitor, radical scavenger, antioxidant, and in cosmetics.

What is lirinidine's CAS number?

The CAS number of lirinidine is 54383-28-7.

What is the predicted boiling point of lirinidine?

The predicted boiling point of lirinidine is 451.4±45.0 °C.

What is the predicted pka value of lirinidine?

The predicted pka value of lirinidine is 9.90±0.20.

※ Please kindly note that our products are for research use only.