Litseglutine B

Catalog Number	ACM25368018
CAS Number	25368-01-8
Structure
Synonyms	N-Methyl-O10-methylhernovine
Molecular Weight	341.4
InChI	InChI=1S/C20H23NO4/c1-21-8-7-12-10-14(22)19(24-3)18-16(12)13(21)9-11-5-6-15(23-2)20(25-4)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3/t13-/m0/s1
InChI Key	MMPSCNRRQGVBGG-ZDUSSCGKSA-N
Purity	95%+
Complexity	475
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	341.16270821
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)OC)OC)O
Monoisotopic Mass	341.16270821
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	51.2 Ų

Custom Q&A

What is the molecular formula of Litseglutine B?

The molecular formula of Litseglutine B is C20H23NO4.

What is the molecular weight of Litseglutine B?

The molecular weight of Litseglutine B is 341.4.

What is the CAS number of Litseglutine B?

The CAS number of Litseglutine B is 25368-01-8.

What are the synonyms of Litseglutine B?

Litseglutine B is also known by the synonym N-Methyl-O10-methylhernovine and 4H-Dibenzo[de,g]quinolin-2-ol, 5,6,6a,7-tetrahydro-1,10,11-trimethoxy-6-methyl-, (6aS)-.

What is the boiling point of Litseglutine B?

The boiling point of Litseglutine B is predicted to be 505.7±50.0 °C.

What is the predicted density of Litseglutine B?

The predicted density of Litseglutine B is 1.222±0.06 g/cm3.

What is the predicted pKa value of Litseglutine B?

The predicted pKa value of Litseglutine B is 9.99±0.20.

How many methyl groups are present in the molecular structure of Litseglutine B?

There are two methyl groups present in the molecular structure of Litseglutine B.

What is the predicted boiling point range of Litseglutine B?

The predicted boiling point range of Litseglutine B is 505.7±50.0 °C.

What is the predicted molecular weight of Litseglutine B?

The predicted molecular weight of Litseglutine B is 341.4.

※ Please kindly note that our products are for research use only.