Liwaconitine

Liwaconitine

Inquiry
Catalog Number ACM86408153
CAS Number 86408-15-3
Description Liwaconitine is a diterpenoid alkaloid found in the aconite root. It is used as a medicinal plant and is classified as a member of the Ranunculaceae family. Liwaconitine has been quantified and classified under the Chinese Pharmacopoeia, and it is also recognized as a medicinal plant of China. The drug has shown biological activity against bacteria, fungi, and cancer cells. Liwaconitine has been shown to inhibit bacterial growth by binding to ribosomes and preventing protein synthesis. It also inhibits the formation of spores in fungi by inhibiting their germination process. Liwaconitine also inhibits tumor cell proliferation through inhibition of DNA synthesis and protein production, leading to cell death.
Synonyms 8-O-(4-Methoxybenzoyl-forestine
Molecular Weight 735.86 g/mol
Molecular Formula C41H53NO11
Canonical SMILES CCN1C[C@@]2(CCC(C34[C@@H]2C(C(C31)C5(C[C@@H]([C@]6(C[C@@H]4[C@@H]5[C@H]6OC(=O)C7=CC=C(C=C7)OC)O)OC)OC(=O)C8=CC=C(C=C8)OC)OC)OC)COC
Storage store at 10℃-25℃
MDL Number MFCD00238629
Custom Q&A

What is the chemical structure of Liwaconitine?

The chemical structure of Liwaconitine is C41H53NO11.

What is the molecular weight of Liwaconitine?

The molecular weight of Liwaconitine is 735.86.

What are some synonyms for Liwaconitine?

Some synonyms for Liwaconitine are LIWACONITINE and 8-O-(4-METHOXYBENZOYL)-FORESTINE.

What are the molecular formula and structure of Liwaconitine?

The molecular formula of Liwaconitine is C41H53NO11.

What is the product name of Liwaconitine?

The product name of Liwaconitine is 8-O-(4-METHOXYBENZOYL)-FORESTINE.

What type of compound is Liwaconitine?

Liwaconitine is a natural alkaloid compound.

What is the role of Liwaconitine in pharmacology?

Liwaconitine is known for its potential pharmacological activity as a therapeutic agent.

How is Liwaconitine typically used in research?

Liwaconitine is typically used in research related to its biological and pharmacological properties.

What are some potential applications of Liwaconitine in medicine?

Liwaconitine may have potential applications in medicine for pain management and other therapeutic purposes.

Can Liwaconitine be chemically modified for specific purposes?

Yes, Liwaconitine can be chemically modified, such as in the case of 8-O-(4-METHOXYBENZOYL)-FORESTINE, to tailor its properties for different applications in science and medicine.

※ Please kindly note that our products are for research use only.