Lobelanine

Catalog Number	ACM579215
CAS Number	579-21-5
Structure
Synonyms	2,2'-(1-Methyl-2,6-piperidinediyl)diacetophenon
Molecular Weight	335.4
InChI	InChI=1S/C22H25NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-20H,8,13-16H2,1H3/t19-,20+
InChI Key	IDEMKXUAULKYJV-BGYRXZFFSA-N
Melting Point	172 °C
Purity	95%+
Complexity	409
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	335.18852904
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1[C@H](CCC[C@H]1CC(=O)C2=CC=CC=C2)CC(=O)C3=CC=CC=C3
Monoisotopic Mass	335.18852904
PhysicalState	Solid
Rotatable Bond Count	6
Topological Polar Surface Area	37.4 Ų

Custom Q&A

What is another name for 2,2'-(1-Methyl-2,6-piperidinediyl)diacetophenon?

It is also known as Lobelanine

What is the chemical formula of 2,2'-(1-Methyl-2,6-piperidinediyl)diacetophenon?

The chemical formula is C22H25NO2

What is the molecular weight of Lobelanine?

The molecular weight is 335.44 g/mol

What is the melting point of Lobelanine?

The melting point is 99°C

What is the boiling point of 2,2'-(1-Methyl-2,6-piperidinediyl)diacetophenon?

The boiling point is approximately 472.07°C

What is the predicted pKa value for Lobelanine?

The predicted pKa value is 9.42±0.10

What is the usage of Lobelanine?

It is used as an analog of Lobeline, a neuronal nicotinic acetylcholine receptor agonist, and a CNS stimulant

What is the safety information for Lobelanine?

RIDADR: 1544, HazardClass: 6.1(b), PackingGroup: III

What category does Lobelanine belong to?

It belongs to the category of alkaloids

What is the refractive index of Lobelanine?

The estimated refractive index is 1.5614

※ Please kindly note that our products are for research use only.