Lochnerine

Catalog Number	ACM522474
CAS Number	522-47-4
Synonyms	10-Methoxysarpagan-17-ol
Molecular Weight	324.4
InChI	InChI=1S/C20H24N2O2/c1-3-11-9-22-18-8-15-14-6-12(24-2)4-5-17(14)21-20(15)19(22)7-13(11)16(18)10-23/h3-6,13,16,18-19,21,23H,7-10H2,1-2H3/b11-3-/t13-,16+,18-,19-/m0/s1
InChI Key	YTIVOMMYBBBYFH-BOPWJTLDSA-N
Melting Point	202.5-203.5 °C
Purity	95%+
Complexity	536
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	324.183778013
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@H]([C@@H]2CC4=C3NC5=C4C=C(C=C5)OC)CO
Monoisotopic Mass	324.183778013
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	48.5 Ų

Custom Q&A

What is the chemical name of LOCHNERINE?

(+)-Lochenerine

Where can LOCHNERINE be obtained from?

LOCHNERINE can be obtained from Lochnera rosea and is also present in curare (Strychnos toxifera).

What is the melting point of LOCHNERINE?

The melting point of LOCHNERINE is 202.5-203.5°C.

What are some synonyms for LOCHNERINE?

Some synonyms for LOCHNERINE are 10-Methoxysarpagan-17-ol, 10-Methoxynormacusine B, and Luo Ke alkali.

How is the structure of LOCHNERINE described?

The structure of LOCHNERINE is described as that of O-methylsarpagine.

What is the molecular formula of LOCHNERINE?

The molecular formula of LOCHNERINE is C20H24N2O2.

What is the molecular weight of LOCHNERINE?

The molecular weight of LOCHNERINE is 324.422.

What are some characteristic derivatives of LOCHNERINE?

Some characteristic derivatives of LOCHNERINE are the double melting point of its crystalline picrate and the p-toluenesulphonyl derivative.

How does LOCHNERINE yield the O-acetate derivative?

LOCHNERINE yields the O-acetate derivative as colorless needles with a melting point of 243°C.

What are some references for studies on LOCHNERINE?

Some references for studies on LOCHNERINE are Janot, LeMen., Mors et al., Arnold et al., and Karrer et al.

※ Please kindly note that our products are for research use only.