Longistylumphylline A

Catalog Number	ACM857672345
CAS Number	857672-34-5
Molecular Weight	367.5
InChI	InChI=1S/C23H29NO3/c1-12-10-24-11-14-6-4-13-5-7-15-17(21(26)27-3)9-23(19(13)15)20(25)16(12)8-18(24)22(14,23)2/h12,14,16,18H,4-11H2,1-3H3/t12-,14-,16-,18-,22-,23+/m1/s1
InChI Key	ABIPGLGIPJKDMN-ZTOHPJANSA-N
Purity	95%+
Complexity	854
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	367.21474379
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1CN2C[C@H]3CCC4=C5C(=C(C[C@]56[C@]3([C@H]2C[C@H]1C6=O)C)C(=O)OC)CC4
Monoisotopic Mass	367.21474379
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	46.6 Ų

Custom Q&A

What is the chemical formula of Longistylumphylline A?

The chemical formula of Longistylumphylline A is C23H29NO3.

What is the molecular weight of Longistylumphylline A?

The molecular weight of Longistylumphylline A is 367.48.

What is the solubility of Longistylumphylline A?

Longistylumphylline A is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

In what form is Longistylumphylline A commonly found?

Longistylumphylline A is commonly found in powder form.

What is the CAS number of Longistylumphylline A?

The CAS number of Longistylumphylline A is 857672-34-5.

What are the synonyms of Longistylumphylline A?

The synonyms of Longistylumphylline A are 1H-11,12c-Methanocyclopent[1,8]azuleno[4,5-a]indolizine-2-carboxylic acid, 3,4,5,6,6a,7,9,10,11,12,12a,12b-dodecahydro-10,12b-dimethyl-13-oxo-, methyl ester, (6aR,10R,11S,12aS,12bR,12cS)-rel-(-)-.

What is the molecular structure of Longistylumphylline A?

The molecular structure of Longistylumphylline A is in the form of a dodecahydro indolizine.

What are the different chemical properties of Longistylumphylline A?

Longistylumphylline A is soluble in various solvents such as Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

How is Longistylumphylline A commonly used?

Longistylumphylline A is commonly used in its powder form.

What is the stereochemistry of Longistylumphylline A?

The stereochemistry of Longistylumphylline A is (6aR,10R,11S,12aS,12bR,12cS)-rel-(-)-.

※ Please kindly note that our products are for research use only.