Lycodoline

Catalog Number	ACM6900921
CAS Number	6900-92-1
Structure
Synonyms	(1S,8aS,9S,11R,12aS)-Dodecahydro-8a-hydroxy-11-methyl-1,9-ethanobenzo[i]quinolizin-14-one
Molecular Weight	263.37
InChI	InChI=1S/C16H25NO2/c1-11-8-12-9-14(18)13-4-2-6-17-7-3-5-16(12,19)15(13,17)10-11/h11-13,19H,2-10H2,1H3/t11-,12+,13-,15+,16+/m1/s1
InChI Key	DBMXKPOCXQNWOQ-WALBABNVSA-N
Melting Point	180-181 °C
Purity	95%+
Complexity	423
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	263.18852904
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H]1C[C@H]2CC(=O)[C@H]3CCCN4[C@]3(C1)[C@@]2(CCC4)O
Monoisotopic Mass	263.18852904
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the chemical formula for Lycodoline?

The chemical formula for Lycodoline is C16H25NO2.

What is the molecular weight of Lycodoline?

The molecular weight of Lycodoline is 263.38.

What is the melting point of Lycodoline?

The melting point of Lycodoline is 180-181℃.

In what solvents is Lycodoline soluble?

Lycodoline is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of Lycodoline?

Lycodoline is in crystalline form.

What is the predicted pka of Lycodoline?

The predicted pka of Lycodoline is 15.24±0.40.

Where is Lycodoline derived from?

Lycodoline is derived from the Phlegmariurus squarrosus plant.

What activity does Lycodoline display?

Lycodoline displays anti-cholinesterase activity.

What is another term for Lycodoline in regulatory standards?

Lycodoline is also known as Lycodoline USP/EP/BP in regulatory standards.

What is the predicted boiling point of Lycodoline?

The predicted boiling point of Lycodoline is 412.7±45.0 °C.

※ Please kindly note that our products are for research use only.