Lycopsamine N-oxide

Catalog Number	ACM95462150
CAS Number	95462-15-0
Synonyms	(1R,7aR)-2,3,5,7a-Tetrahydro-1α-hydroxy-7-[[(2S,3S)-2,3-dihydroxy-2-isopropylbutyryl]oxymethyl]-1H-pyrrolizine 4-oxide
Molecular Weight	315.36
InChI	InChI=1S/C15H25NO6/c1-9(2)15(20,10(3)17)14(19)22-8-11-4-6-16(21)7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12+,13+,15-,16/m0/s1
InChI Key	DNAWGBOKUFFVMB-FVZLBROTSA-N
Purity	90%+
Complexity	479
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	315.16818752
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@@H]([C@@](C(C)C)(C(=O)OCC1=CC[N+]2([C@H]1[C@@H](CC2)O)[O-])O)O
Monoisotopic Mass	315.16818752
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	105 Ų

Custom Q&A

What is the chemical name of lycopsamine N-oxide?

The chemical name of lycopsamine N-oxide is (1R,7aR)-2,3,5,7a-Tetrahydro-1α-hydroxy-7-[[(2S,3S)-2,3-dihydroxy-2-isopropylbutyryl]oxymethyl]-1H-pyrrolizine 4-oxide.

What is the CAS number of lycopsamine N-oxide?

The CAS number of lycopsamine N-oxide is 95462-15-0.

What is the molecular formula of lycopsamine N-oxide?

The molecular formula of lycopsamine N-oxide is C15H25NO6.

What is the molecular weight of lycopsamine N-oxide?

The molecular weight of lycopsamine N-oxide is 315.36 g/mol.

What are the product categories lycopsamine N-oxide belongs to?

Lycopsamine N-oxide belongs to the product categories of Amines and Heterocycles.

What is the melting point of lycopsamine N-oxide?

The melting point of lycopsamine N-oxide is greater than 70°C (dec.).

How should lycopsamine N-oxide be stored?

Lycopsamine N-oxide should be stored at -20°C.

What is the solubility of lycopsamine N-oxide in chloroform and methanol?

Lycopsamine N-oxide is slightly soluble in chloroform and methanol.

What are the safety hazards associated with lycopsamine N-oxide?

Lycopsamine N-oxide is classified as RIDADR 1544 and HazardClass 6.1(b) with PackingGroup III.

What are the known uses of lycopsamine N-oxide?

Lycopsamine N-oxide is known to occur in pyrrolizidine alkaloid-containing plants, which are poisonous to livestock, wildlife, and humans due to their hepatotoxic and tumorigenic effects.

※ Please kindly note that our products are for research use only.