Lycorenine

Lycorenine

Inquiry
Catalog Number ACM477190
CAS Number 477-19-0
Structure
Synonyms 9,10-Dimethoxy-1-methyllycorenan-7α-ol
Molecular Weight 317.4
Molecular Formula C18H23NO4
InChI InChI=1S/C18H23NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-18,20H,5-7H2,1-3H3/t13-,16-,17-,18+/m1/s1
InChI Key VHYYSQODIQWPDO-PILAGYSTSA-N
Melting Point 199-200 °C
Purity 95%+
Density 1.28g/cm³
Complexity 482
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 317.16270821
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 1
Isomeric SMILES CN1CCC2=CC[C@@H]3[C@H]([C@@H]21)C4=CC(=C(C=C4[C@H](O3)O)OC)OC
Monoisotopic Mass 317.16270821
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 51.2 Ų
Custom Q&A

What is the chemical formula for lycorenine?

The chemical formula for lycorenine is C18H23NO4.

What is the molecular weight of lycorenine?

The molecular weight of lycorenine is 317.38 g/mol.

What is the melting point of lycorenine?

The melting point of lycorenine is 199-200°C.

In what solvents is lycorenine soluble?

Lycorenine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

How does lycorenine behave as a pseudo-base?

Lycorenine behaves as a pseudo-base giving an oxime hydrochloride which decomposes at 258°C.

What is the usage of lycorenine?

Lycorenine is used as an antibacterial agent extracted from the bulb of Lycoris radiata.

What is the target of lycorenine?

The target of lycorenine is antifection.

Where is lycorenine isolated from?

Lycorenine is an alkaloid isolated from Lycoris radiata Herb.

How does lycorenine yield the dihydro-derivative?

Lycorenine yields the dihydro-derivative on catalytic hydrogenation.

What is the specific rotation of lycorenine?

The specific rotation of lycorenine is [α]20D +149.3°.

※ Please kindly note that our products are for research use only.