Lycorenine

Catalog Number	ACM477190
CAS Number	477-19-0
Synonyms	9,10-Dimethoxy-1-methyllycorenan-7α-ol
Molecular Weight	317.4
Molecular Formula	C18H23NO4
InChI	InChI=1S/C18H23NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-18,20H,5-7H2,1-3H3/t13-,16-,17-,18+/m1/s1
InChI Key	VHYYSQODIQWPDO-PILAGYSTSA-N
Melting Point	199-200 °C
Purity	95%+
Density	1.28g/cm³
Complexity	482
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	317.16270821
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CCC2=CC[C@@H]3[C@H]([C@@H]21)C4=CC(=C(C=C4[C@H](O3)O)OC)OC
Monoisotopic Mass	317.16270821
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	51.2 Ų

Custom Q&A

What is the chemical formula for lycorenine?

The chemical formula for lycorenine is C18H23NO4.

What is the molecular weight of lycorenine?

The molecular weight of lycorenine is 317.38 g/mol.

What is the melting point of lycorenine?

The melting point of lycorenine is 199-200°C.

In what solvents is lycorenine soluble?

Lycorenine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

How does lycorenine behave as a pseudo-base?

Lycorenine behaves as a pseudo-base giving an oxime hydrochloride which decomposes at 258°C.

What is the usage of lycorenine?

Lycorenine is used as an antibacterial agent extracted from the bulb of Lycoris radiata.

What is the target of lycorenine?

The target of lycorenine is antifection.

Where is lycorenine isolated from?

Lycorenine is an alkaloid isolated from Lycoris radiata Herb.

How does lycorenine yield the dihydro-derivative?

Lycorenine yields the dihydro-derivative on catalytic hydrogenation.

What is the specific rotation of lycorenine?

The specific rotation of lycorenine is [α]20D +149.3°.

※ Please kindly note that our products are for research use only.