Lycorine hydrobromide

Catalog Number	ACM52456641
CAS Number	52456-64-1
Description	Inhibits protein synthesis; antibacterial, antiviral and anticancer properties
Molecular Weight	368.22 g/mol
Molecular Formula	C16H17NO4·BrH
Canonical SMILES	Br.O[C@H]1C=C2CCN3Cc4cc5OCOc5cc4[C@H]([C@@H]1O)[C@@H]23
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939791000 - UK: 2939490000 - China: 2939799091
MDL Number	MFCD00238633

Custom Q&A

What is the chemical formula of Lycorine hydrobromide?

The chemical formula of Lycorine hydrobromide is C16H18BrNO4.

What is the molecular weight of Lycorine hydrobromide?

The molecular weight of Lycorine hydrobromide is 368.22.

Are there any synonyms for Lycorine hydrobromide?

Yes, Lycorine hydrobromide is also known by the same name as a synonym.

What is the name of the product containing Lycorine hydrobromide?

The product containing Lycorine hydrobromide is called LYCORINE HYDROBROMIDE.

How many carbon atoms are present in the Lycorine hydrobromide molecule?

There are 16 carbon atoms in the Lycorine hydrobromide molecule.

Is Lycorine hydrobromide a naturally occurring compound?

Lycorine hydrobromide is a natural compound derived from certain plant sources.

What is the role of hydrobromide in Lycorine hydrobromide?

The hydrobromide component in Lycorine hydrobromide serves as a counterion to the positively charged nitrogen atom in the molecule.

How does Lycorine hydrobromide compare to other alkaloids in terms of chemical structure?

Lycorine hydrobromide belongs to a class of alkaloids that share a similar backbone structure but may vary in functional groups and substitutions.

What are some potential applications of Lycorine hydrobromide in research or medicine?

Lycorine hydrobromide has been studied for its potential anti-cancer, anti-viral, and anti-inflammatory properties, making it a promising candidate for further research and drug development.

※ Please kindly note that our products are for research use only.