Macrophylline

Catalog Number	ACM27841970
CAS Number	27841-97-0
Structure
Synonyms	(Z)-2-Methyl-2-butenoic acid [(1S,2R,7aR)-hexahydro-2β-hydroxy-1H-pyrrolizin-1β-yl]methyl ester
Molecular Weight	239.31
InChI	InChI=1S/C13H21NO3/c1-3-9(2)13(16)17-8-10-11-5-4-6-14(11)7-12(10)15/h3,10-12,15H,4-8H2,1-2H3/b9-3-/t10-,11-,12+/m1/s1
InChI Key	LVZCTOQMFLAKLI-CSZIUDOQSA-N
Melting Point	42-44 °C
Purity	95%+
Complexity	327
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	239.15214353
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(/C)\C(=O)OC[C@@H]1[C@H]2CCCN2C[C@@H]1O
Monoisotopic Mass	239.15214353
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	49.8 Ų

Custom Q&A

What is the chemical name of the compound known as macrophylline?

The chemical name of macrophylline is (Z)-2-Methyl-2-butenoic acid [(1S,2R,7aR)-hexahydro-2β-hydroxy-1H-pyrrolizin-1β-yl]methyl ester.

What are some synonyms for macrophylline?

Some synonyms for macrophylline include Macrophylline[Senecio], and 2-Butenoic acid, 2-methyl-, [(1S,2R,7aR)-hexahydro-2-hydroxy-1H-pyrrolizin-1-yl]methyl ester, (2Z)-.

What is the CAS number for macrophylline?

The CAS number for macrophylline is 27841-97-0.

What is the molecular formula of macrophylline?

The molecular formula of macrophylline is C13H21NO3.

What is the molecular weight of macrophylline?

The molecular weight of macrophylline is 239.31.

What is the melting point of macrophylline?

The melting point of macrophylline is 42-4°C(50-2°C).

Where has macrophylline been isolated from?

Macrophylline has been isolated from Senecio amphibolus and S. macrophylla MB.

What is the specific rotation of macrophylline?

The specific rotation of macrophylline is [α]20D + 34.52° (c 1.68, EtOH).

What are the products obtained when macrophylline is hydrolyzed with dilute acids?

When hydrolyzed with dilute acids, macrophylline furnishes macronecine and angelic acid.

What category does macrophylline belong to?

Macrophylline is a member of pyrrolizines.

※ Please kindly note that our products are for research use only.