Macusine B

Macusine B

Inquiry
Catalog Number ACM6792070
CAS Number 6792-07-0
Synonyms 17-Hydroxy-4α-methylsarpagan-4-ium
Molecular Weight 309.4
InChI InChI=1S/C20H25N2O/c1-3-12-10-22(2)18-9-15-13-6-4-5-7-17(13)21-20(15)19(22)8-14(12)16(18)11-23/h3-7,14,16,18-19,21,23H,8-11H2,1-2H3/q+1
InChI Key KRTATNOTKFNEFT-UHFFFAOYSA-N
Purity 95%+
Complexity 532
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 309.196688425
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 1
Hydrogen Bond Donor Count 2
Monoisotopic Mass 309.196688425
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 36 Ų
Custom Q&A

What is the synonym for 17-Hydroxy-4α-methylsarpagan-4-ium?

Macusine B

What is the CAS number for 17-Hydroxy-4α-methylsarpagan-4-ium?

6792-07-0

What is the molecular formula of 17-Hydroxy-4α-methylsarpagan-4-ium?

C20H25N2O+

What is the molecular weight of 17-Hydroxy-4α-methylsarpagan-4-ium?

309.43

What is the optical rotation of 17-Hydroxy-4α-methylsarpagan-4-ium?

alpha D22 +15.6° (c = 1.21)

Where has this quaternary alkaloid been isolated from according to the reference?

The stem and root bark of Strychnos species, S. amazonica

What is the source of information for the isolation of Macusine B?

Galeffi et ai., Ann. Chim. (Rome), 63, 849 (1973)

What is the chemical structure of 17-Hydroxy-4α-methylsarpagan-4-ium?

It is a quaternary alkaloid.

What is the significance of isolating Macusine B from S. amazonica?

It provides valuable information on the chemical composition of the plant and potential pharmacological properties.

How is Macusine B important in the field of chemistry and pharmacology?

Its isolation and characterization can lead to further research on its biological activities and potential medicinal uses.

※ Please kindly note that our products are for research use only.