Mahanimbilol

Catalog Number	ACM77156139
CAS Number	77156-13-9
Molecular Weight	333.5
InChI	InChI=1S/C23H27NO/c1-15(2)8-7-9-16(3)12-13-19-22-20(14-17(4)23(19)25)18-10-5-6-11-21(18)24-22/h5-6,8,10-12,14,24-25H,7,9,13H2,1-4H3/b16-12+
InChI Key	JSSIAXXILAGJKE-FOWTUZBSSA-N
Purity	90%+
Complexity	504
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	333.209264485
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC1=CC2=C(C(=C1O)C/C=C(\C)/CCC=C(C)C)NC3=CC=CC=C32
Monoisotopic Mass	333.209264485
PhysicalState	Oil
Rotatable Bond Count	5
Topological Polar Surface Area	36 Ų

Custom Q&A

What is the chemical formula for Mahanimbilol?

The chemical formula for Mahanimbilol is C23H27NO.

What is the molecular weight of Mahanimbilol?

The molecular weight of Mahanimbilol is 333.47.

What are the synonyms for Mahanimbilol?

The synonyms for Mahanimbilol are Mahanimbilol, 9H-Carbazol-2-ol, and Mahanimbinol.

What is the CAS number for Mahanimbilol?

The CAS number for Mahanimbilol is 77156-13-9.

What is the boiling point of Mahanimbilol?

The boiling point of Mahanimbilol is predicted to be 540.8±38.0 °C.

What is the density of Mahanimbilol?

The density of Mahanimbilol is predicted to be 1.102±0.06 g/cm3.

What is the pka value of Mahanimbilol?

The pka value of Mahanimbilol is predicted to be 10.54±0.30.

How is Mahanimbilol defined in ChEBI?

Mahanimbilol is defined as a member of carbazoles in ChEBI.

What is the predicted boiling point of Mahanimbilol?

The predicted boiling point of Mahanimbilol is 540.8±38.0 °C.

※ Please kindly note that our products are for research use only.