Mallorepine

Mallorepine

Inquiry
Catalog Number ACM767986
CAS Number 767-98-6
Structure
Synonyms 1,4-Dihydro-1-methyl-4-oxo-3-pyridinecarbonitrile
Molecular Weight 134.14
InChI InChI=1S/C7H6N2O/c1-9-3-2-7(10)6(4-8)5-9/h2-3,5H,1H3
InChI Key VVNHMAOQCMDJHT-UHFFFAOYSA-N
Purity 95%+
Complexity 267
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 134.048012819
Heavy Atom Count 10
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Monoisotopic Mass 134.048012819
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 44.1 Ų
Custom Q&A

What is the predicted pka value of 1,4-Dihydro-1-methyl-4-oxo-3-pyridinecarbonitrile?

The predicted pka value of 1,4-Dihydro-1-methyl-4-oxo-3-pyridinecarbonitrile is -0.05±0.10.

What are some synonyms for 1,4-Dihydro-1-methyl-4-oxo-3-pyridinecarbonitrile?

Some synonyms for 1,4-Dihydro-1-methyl-4-oxo-3-pyridinecarbonitrile include Mallorepine and 1-Methyl-4-oxo-1,4-dihydropyridine-3-carbonitrile.

What is the molecular formula of Mallorepine?

The molecular formula of Mallorepine is C7H6N2O.

What is the molecular weight of Mallorepine?

The molecular weight of Mallorepine is 134.14.

What is the melting point of 1,4-Dihydro-1-methyl-4-oxo-3-pyridinecarbonitrile?

The melting point of 1,4-Dihydro-1-methyl-4-oxo-3-pyridinecarbonitrile is 179-181 °C.

What is the predicted boiling point of Mallorepine?

The predicted boiling point of Mallorepine is 221.8±40.0 °C.

What is the predicted density of the compound?

The predicted density of the compound is 1.22±0.1 g/cm3.

What is the recommended storage temperature for Mallorepine?

The recommended storage temperature for Mallorepine is 2-8°C.

※ Please kindly note that our products are for research use only.