Mecambridine

Catalog Number	ACM31098609
CAS Number	31098-60-9
Structure
Synonyms	(-)-Oreophiline
Molecular Weight	399.4
InChI	InChI=1S/C22H25NO6/c1-25-17-7-13-9-23-5-4-12-6-18-21(29-11-28-18)22(27-3)19(12)16(23)8-14(13)15(10-24)20(17)26-2/h6-7,16,24H,4-5,8-11H2,1-3H3/t16-/m0/s1
InChI Key	RJZGHQFMKACAHM-INIZCTEOSA-N
Purity	95%+
Complexity	578
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	399.16818752
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	1
Isomeric SMILES	COC1=C(C(=C2C[C@H]3C4=C(C5=C(C=C4CCN3CC2=C1)OCO5)OC)CO)OC
Monoisotopic Mass	399.16818752
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	69.6 Ų

Custom Q&A

What is the chemical formula of mecambridine?

The chemical formula of mecambridine is C22H25NO6.

What is the molecular weight of mecambridine?

The molecular weight of mecambridine is 399.44.

What is the CAS number of mecambridine?

The CAS number of mecambridine is 31098-60-9.

What is the melting point of mecambridine?

The melting point of mecambridine is 177-178 °C.

What is the solubility of mecambridine?

Mecambridine is soluble in methanol.

What is the boiling point of mecambridine?

The boiling point of mecambridine is predicted to be 536.5±50.0 °C.

What is the density of mecambridine?

The density of mecambridine is predicted to be 1.38±0.1 g/cm3.

What is the pka value of mecambridine?

The pka value of mecambridine is predicted to be 14.18±0.10.

What is the main use of mecambridine?

Mecambridine is an alkaloid with anticancer activity.

What is another name for mecambridine?

Another name for mecambridine is (-)-Oreophiline.

※ Please kindly note that our products are for research use only.