Melicopidine

Melicopidine

Inquiry
Catalog Number ACM475912-1
CAS Number 475-91-2
Description Melicopidine is a natural compound with cytotoxic and anti-cancer properties. It is found in the genus Melicope, which belongs to the Rutaceae family. This plant contains many chemical compounds, including acridone, which has been shown to have anti-cancer properties. Melicopidine has been shown to inhibit the growth of human cervical cancer cells at low concentrations by blocking cell cycle progression. The mechanism of action is not yet known, but it may be due to melicopidine's ability to bind with DNA and alter its structure or its inhibition of protein synthesis. Melicopidine has also been shown to have toxicological effects on animals at high doses, such as weight loss and erythema (redness).
Molecular Weight 313.3 g/mol
Molecular Formula C17H15NO5
Canonical SMILES CN1C2=CC=CC=C2C(=O)C3=C1C(=C4C(=C3OC)OCO4)OC
Storage store at 10℃-25℃
Custom Q&A

What is the chemical formula of Melicopidine?

The chemical formula of Melicopidine is C17H15NO5.

What is the molecular weight of Melicopidine?

The molecular weight of Melicopidine is 313.3.

What is the synonyms of Melicopidine?

The synonyms of Melicopidine include 4,11-dimethoxy-5-methyl-[1,3]dioxolo[4,5-b]acridin-10-one and Melicopidene.

What is the CAS number of Melicopidine?

The CAS number of Melicopidine is 475-91-2.

What is the melting point of Melicopidine?

The melting point of Melicopidine is 121-122°C.

What is the boiling point of Melicopidine?

The boiling point of Melicopidine is 530.4±50.0°C.

How is Melicopidine classified in terms of its chemical properties?

Melicopidine is classified as a member of acridines.

How is Melicopidine functionally related to?

Melicopidine is functionally related to an acridone.

What is the density of Melicopidine?

The density of Melicopidine is 1.345±0.06 g/cm3.

What is the pka value of Melicopidine?

The pka value of Melicopidine is -1.32±0.20.

※ Please kindly note that our products are for research use only.