Meloscandonine

Catalog Number	ACM28645274
CAS Number	28645-27-4
Structure
Synonyms	(12aβ,14aS)-13,14-Dihydro-8α-methyl-6aα,8aα-methano-11H,12aH-benzo[k]pyrrolo[3,2,1-mn][1,8]phenanthroline-6,7(5H,8H)-dione
Molecular Weight	320.4
InChI	InChI=1S/C20H20N2O2/c1-12-15(23)20-11-18(12)7-4-9-22-10-8-19(20,16(18)22)13-5-2-3-6-14(13)21-17(20)24/h2-7,12,16H,8-11H2,1H3,(H,21,24)/t12-,16-,18-,19+,20+/m0/s1
InChI Key	RVVXEECWQBKQNP-DJKGFLTMSA-N
Purity	95%+
Complexity	702
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	320.152477885
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1C(=O)[C@@]23C[C@@]14C=CCN5[C@@H]4[C@@]2(CC5)C6=CC=CC=C6NC3=O
Monoisotopic Mass	320.152477885
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the full chemical name of Meloscandonine?

The full chemical name of Meloscandonine is (12aβ,14aS)-13,14-Dihydro-8α-methyl-6aα,8aα-methano-11H,12aH-benzo[k]pyrrolo[3,2,1-mn][1,8]phenanthroline-6,7(5H,8H)-dione.

What is the molecular formula of Meloscandonine?

The molecular formula of Meloscandonine is C20H20N2O2.

What is the molecular weight of Meloscandonine?

The molecular weight of Meloscandonine is 320.39.

What is the boiling point of Meloscandonine?

The boiling point of Meloscandonine is predicted to be 578.3±50.0 °C.

What is the density of Meloscandonine?

The density of Meloscandonine is predicted to be 1.40±0.1 g/cm3.

What is the pka value of Meloscandonine?

The pka value of Meloscandonine is 12.55±0.40.

What is any synonyms for Meloscandonine?

Some synonyms for Meloscandonine include Meloscandonine and 6a,8a-Methano-11H,12aH-benzo[k]pyrrolo[3,2,1-mn][1,8]phenanthroline-6,7(5H,8H)-dione.

What is the chemical structure of Meloscandonine?

The chemical structure of Meloscandonine is (12aβ,14aS)-13,14-Dihydro-8α-methyl-6aα,8aα-methano-11H,12aH-benzo[k]pyrrolo[3,2,1-mn][1,8]phenanthroline-6,7(5H,8H)-dione.

How is Meloscandonine typically used or studied?

Meloscandonine may be studied for its pharmacological properties or potential therapeutic applications.

Is Meloscandonine commercially available or used in any specific research studies?

Further research or specific studies may be needed to determine the commercial availability or specific uses of Meloscandonine.

※ Please kindly note that our products are for research use only.