Menisperine

Menisperine

Inquiry
Catalog Number ACM25342829
CAS Number 25342-82-9
Structure
Synonyms Corydine impurity 1
Molecular Weight 356.4
InChI InChI=1S/C21H25NO4/c1-22(2)9-8-13-11-16(25-4)21(26-5)19-17(13)14(22)10-12-6-7-15(24-3)20(23)18(12)19/h6-7,11,14H,8-10H2,1-5H3/p+1/t14-/m0/s1
InChI Key XQINTCORIZHGFD-AWEZNQCLSA-O
Purity 95%+
Complexity 512
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 1
Exact Mass 356.18618331
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Isomeric SMILES C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC)C
Monoisotopic Mass 356.18618331
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 47.9 Ų
Custom Q&A

What is the product name of menisperine?

The product name of menisperine is menisperine.

What are some synonyms for menisperine?

Some synonyms for menisperine are menisperine and Corydine Impurity 1.

What is the CAS number for menisperine?

The CAS number for menisperine is 25342-82-9.

What is the molecular formula of menisperine?

The molecular formula of menisperine is C21H26NO4+.

What is the molecular weight of menisperine?

The molecular weight of menisperine is 356.44.

What is the melting point of menisperine?

The melting point of menisperine is 235 °C.

How many atoms are present in the molecular formula of menisperine?

There are 47 atoms present in the molecular formula of menisperine.

What is the structure of the menisperine molecule?

The structure of the menisperine molecule contains 21 carbon atoms, 26 hydrogen atoms, one nitrogen atom, and four oxygen atoms.

How is menisperine classified in terms of chemical properties?

Menisperine is classified as a compound with a relatively high molecular weight and a specific melting point.

What type of products may contain menisperine as an ingredient?

Products such as pharmaceuticals or research chemicals may contain menisperine as an ingredient.

※ Please kindly note that our products are for research use only.