Meropenem

Meropenem

Inquiry
Catalog Number ACM96036032-2
CAS Number 96036-03-2
Structure
Synonyms SM 7338
Molecular Weight 383.46
Molecular Formula C17H25N3O5S
Canonical SMILES O=C(C(N12)=C(S[C@@H]3CN[C@H](C(N(C)C)=O)C3)[C@H](C)[C@]2([H])[C@@H]([C@H](O)C)C1=O)O
Purity 98%+
Appearance White to off-white solid
Storage Powder: -20 °C, 3 years; 4 °C, 2 years
In solvent: -80 °C, 6 months; -20 °C, 1 month
Custom Q&A

What is the chemical formula for piperine?

The chemical formula for piperine is C17H19NO3.

What is the molecular weight of piperine?

The molecular weight of piperine is 285.34.

What is the boiling point of piperine?

The boiling point of piperine is predicted to be 498.5±40.0 °C.

What is the InChIKey for piperine?

The InChIKey for piperine is MXXWOMGUGJBKIW-UHFFFAOYSA-N.

What is the LogP value of piperine?

The LogP value of piperine is 3.365 (estimated).

Where is piperine isolated from?

Piperine is an alkaloid isolated from the plant Piper nigrum.

What is the role of piperine as indicated in the reference?

Piperine has a role as a NF-kappaB inhibitor, a plant metabolite, a food component, and a human blood serum metabolite.

What is the synonym for piperine that contains the word "Sichuan"?

One of the synonyms for piperine is "Sichuan Pepper oil".

What is the chemical property of piperine that is predicted to be 1.211±0.06 g/cm3?

The density of piperine is predicted to be 1.211±0.06 g/cm3.

How is piperine structurally related to (E,E)-piperic acid?

Piperine is functionally related to (E,E)-piperic acid.

※ Please kindly note that our products are for research use only.