Merucathine

Catalog Number	ACM107673745
CAS Number	107673-74-5
Structure
Synonyms	(1E,3R,4S)-4-Amino-1-phenyl-1-penten-3-ol
Molecular Weight	177.24
InChI	InChI=1S/C11H15NO/c1-9(12)11(13)8-7-10-5-3-2-4-6-10/h2-9,11,13H,12H2,1H3/b8-7+/t9-,11+/m0/s1
InChI Key	MSCXFOZFDVCLHC-PRXIFDQHSA-N
Purity	95%+
Complexity	162
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	177.115364102
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@@H]([C@@H](/C=C/C1=CC=CC=C1)O)N
Monoisotopic Mass	177.115364102
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	46.2 Ų

Custom Q&A

What is the chemical formula of Merucathine?

The chemical formula of Merucathine is C11H15NO.

What is the molecular weight of Merucathine?

The molecular weight of Merucathine is 177.24 g/mol.

What is the CAS number for Merucathine?

The CAS number for Merucathine is 107673-74-5.

What are the synonyms for Merucathine?

The synonyms for Merucathine are Merucathine and (1E,3R,4S)-4-Amino-1-phenyl-1-penten-3-ol.

What is the predicted boiling point of Merucathine?

The predicted boiling point of Merucathine is 340.8±42.0 °C.

What is the predicted density of Merucathine?

The predicted density of Merucathine is 1.071±0.06 g/cm3.

What is the predicted pka value of Merucathine?

The predicted pka value of Merucathine is 12.32±0.45.

※ Please kindly note that our products are for research use only.