Merucathinone

Catalog Number	ACM107638802
CAS Number	107638-80-2
Structure
Synonyms	(E,4S)-4-Amino-1-phenylpent-1-en-3-one
Molecular Weight	175.23
InChI	InChI=1S/C11H13NO/c1-9(12)11(13)8-7-10-5-3-2-4-6-10/h2-9H,12H2,1H3/b8-7+/t9-/m0/s1
InChI Key	ARWKEKBMGMURNX-FLOXNTQESA-N
Purity	95%+
Complexity	192
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	175.099714038
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H](C(=O)/C=C/C1=CC=CC=C1)N
Monoisotopic Mass	175.099714038
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	43.1 Ų

Custom Q&A

What is the product name of the chemical compound with the CAS number 107638-80-2?

The product name is Merucathinone.

What are some synonyms of Merucathinone?

Some synonyms of Merucathinone are (E,4S)-4-amino-1-phenylpent-1-en-3-one and 1-Penten-3-one, 4-amino-1-phenyl-, (1E,4S)-.

What is the molecular formula of Merucathinone?

The molecular formula of Merucathinone is C11H13NO.

What is the molecular weight of Merucathinone?

The molecular weight of Merucathinone is 175.23 g/mol.

How many atoms of carbon are present in the molecular formula of Merucathinone?

There are 11 carbon atoms in the molecular formula of Merucathinone.

What is the total number of atoms in the molecular formula of Merucathinone?

The total number of atoms in the molecular formula of Merucathinone is 25.

What is the chemical structure of Merucathinone?

The chemical structure of Merucathinone is (E,4S)-4-amino-1-phenylpent-1-en-3-one.

What is the IUPAC name for Merucathinone?

The IUPAC name for Merucathinone is (E,4S)-4-amino-1-phenylpent-1-en-3-one.

※ Please kindly note that our products are for research use only.