Methoxyadiantifoline

Methoxyadiantifoline

Inquiry
Catalog Number ACM115452090
CAS Number 115452-09-0
Structure
Synonyms (6aS)-9-[4,5-Dimethoxy-2-[[[(1S)-1β,2,3,4-tetrahydro-5,6,7-trimethoxy-2-methylisoquinolin]-1α-yl]methyl]phenoxy]-5,6,6aα,7-tetrahydro-1,2,3,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinoline
Molecular Weight 756.9
InChI InChI=1S/C43H52N2O10/c1-44-14-12-25-28(21-36(49-6)41(52-9)39(25)50-7)29(44)17-24-19-32(46-3)34(48-5)22-31(24)55-35-18-23-16-30-37-26(13-15-45(30)2)40(51-8)43(54-11)42(53-10)38(37)27(23)20-33(35)47-4/h18-22,29-30H,12-17H2,1-11H3/t29-,30-/m0/s1
InChI Key NMCGVMFQTRAOOV-KYJUHHDHSA-N
Purity 95%+
Complexity 1220
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 2
Exact Mass 756.36219586
Heavy Atom Count 55
Hydrogen Bond Acceptor Count 12
Hydrogen Bond Donor Count 0
Isomeric SMILES CN1CCC2=C3[C@@H]1CC4=CC(=C(C=C4C3=C(C(=C2OC)OC)OC)OC)OC5=CC(=C(C=C5C[C@H]6C7=CC(=C(C(=C7CCN6C)OC)OC)OC)OC)OC
Monoisotopic Mass 756.36219586
PhysicalState Powder
Rotatable Bond Count 13
Topological Polar Surface Area 98.8 Ų
Custom Q&A

What is the product name of methoxyadiantifoline?

The product name of methoxyadiantifoline is methoxyadiantifoline.

What are the synonyms of methoxyadiantifoline?

The synonyms of methoxyadiantifoline are given as:
1. (6aS)-9-[4,5-Dimethoxy-2-[[[(1S)-1β,2,3,4-tetrahydro-5,6,7-trimethoxy-2-methylisoquinolin]-1α-yl]methyl]phenoxy]-5,6,6aα,7-tetrahydro-1,2,3,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinoline
2. 4H-Dibenzo[de,g]quinoline, 9-[4,5-dimethoxy-2-[(1,2,3,4-tetrahydro-5,6,7-trimethoxy-2-methyl-1-isoquinolinyl)methyl]phenoxy]-5,6,6a,7-tetrahydro-1,2,3,10-tetramethoxy-6-methyl-, [S-(R*,R*)]- (9CI)

What is the CAS number of methoxyadiantifoline?

The CAS number of methoxyadiantifoline is 115452-09-0.

What is the molecular formula of methoxyadiantifoline?

The molecular formula of methoxyadiantifoline is C43H52N2O10.

What is the molecular weight of methoxyadiantifoline?

The molecular weight of methoxyadiantifoline is 756.88.

What functional groups are present in the chemical structure of methoxyadiantifoline?

The chemical structure of methoxyadiantifoline contains methoxy, methyl, and phenoxy functional groups.

Can methoxyadiantifoline be used as a pharmaceutical agent?

The chemical structure and properties of methoxyadiantifoline suggest that it may have potential pharmaceutical applications.

What is the potential biological activity of methoxyadiantifoline?

Methoxyadiantifoline may interact with biological systems due to its unique structural features, potentially leading to specific pharmacological effects.

Is methoxyadiantifoline a commonly used compound in research studies?

Methoxyadiantifoline is a relatively rare compound and may be limited to specific research areas such as pharmacology and medicinal chemistry.

※ Please kindly note that our products are for research use only.