8-Methoxyfissistigine C

Catalog Number	ACM20824184
CAS Number	20824-18-4
IUPAC Name	4,5,11,13-Tetramethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,10,13-pentaen-12-one
Molecular Weight	371.43
Molecular Formula	C21H25NO5
Canonical SMILES	CN1CCC23C=C(C(=O)C(=C2C1CC4=CC(=C(C=C34)OC)OC)OC)OC
InChI	InChI=1S/C21H25NO5/c1-22-7-6-21-11-17(26-4)19(23)20(27-5)18(21)14(22)8-12-9-15(24-2)16(25-3)10-13(12)21/h9-11,14H,6-8H2,1-5H3
InChI Key	CLLFCZIFJSTLRT-UHFFFAOYSA-N
Purity	96%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	686
Exact Mass	371.17327290
Heavy Atom Count	27
Monoisotopic Mass	371.17327290
Topological Polar Surface Area	57.2Ų

Custom Q&A

What is the chemical formula for 8-Methoxyfissistigine C?

The chemical formula for 8-Methoxyfissistigine C is C21H25NO5.

What is the molecular weight of 8-Methoxyfissistigine C?

The molecular weight of 8-Methoxyfissistigine C is 371.43.

What is the CAS number for 8-Methoxyfissistigine C?

The CAS number for 8-Methoxyfissistigine C is 20824-18-4.

What are some synonyms for 8-Methoxyfissistigine C?

Some synonyms for 8-Methoxyfissistigine C are Protostephanone and Morphinan-7-one, 5,6,8,14-tetradehydro-2,3,6,8-tetramethoxy-17-methyl-, (9ξ,13ξ)-.

What is the predicted boiling point of 8-Methoxyfissistigine C?

The predicted boiling point of 8-Methoxyfissistigine C is 556.4±50.0 °C.

What is the predicted density of 8-Methoxyfissistigine C?

The predicted density of 8-Methoxyfissistigine C is 1.26±0.1 g/cm3.

What is the predicted pKa value of 8-Methoxyfissistigine C?

The predicted pKa value of 8-Methoxyfissistigine C is 6.37±0.60.

How many oxygen atoms are present in the chemical formula of 8-Methoxyfissistigine C?

There are five oxygen atoms present in the chemical formula of 8-Methoxyfissistigine C.

What is another name for 8-Methoxyfissistigine C that indicates its chemical structure?

Another name for 8-Methoxyfissistigine C that indicates its chemical structure is 5,6,8,14-tetradehydro-2,3,6,8-tetramethoxy-17-methyl-.

※ Please kindly note that our products are for research use only.