8-Methoxyflindersine

Catalog Number	ACM35989005
CAS Number	35989-00-5
IUPAC Name	7-Methoxy-2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one
Molecular Weight	257.30
Molecular Formula	C15H15NO3
Canonical SMILES	CC1(C=CC2=C(O1)C3=C(C(=CC=C3)OC)NC2=O)C
InChI	InChI=1S/C15H15NO3/c1-15(2)8-7-10-13(19-15)9-5-4-6-11(18-3)12(9)16-14(10)17/h4-8H,1-3H3,(H,16,17)
InChI Key	YBYSRJYNHOVUKM-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	464
Exact Mass	257.10519334
Heavy Atom Count	19
Monoisotopic Mass	257.10519334
Topological Polar Surface Area	47.6Ų

Custom Q&A

What is the chemical name of 8-Methoxyflindersine?

The chemical name is 5H-Pyrano[3,2-c]quinolin-5-one, 2,6-dihydro-7-methoxy-2,2-dimethyl-

What is another name for 8-Methoxyflindersine?

Another name for 8-Methoxyflindersine is 8-methoxyflindersine.

What is the molecular formula of 5H-Pyrano[3,2-c]quinolin-5-one, 2,6-dihydro-7-methoxy-2,2-dimethyl-?

The molecular formula is C15H15NO3.

What is the molecular weight of 8-Methoxyflindersine?

The molecular weight is 257.28.

What is the melting point of 5H-Pyrano[3,2-c]quinolin-5-one, 2,6-dihydro-7-methoxy-2,2-dimethyl-?

The melting point is 180 °C.

What is the predicted boiling point of 8-Methoxyflindersine?

The predicted boiling point is 477.1±45.0 °C.

What is the predicted density of 8-Methoxyflindersine?

The predicted density is 1.26±0.1 g/cm3.

What is the predicted pKa value of 5H-Pyrano[3,2-c]quinolin-5-one, 2,6-dihydro-7-methoxy-2,2-dimethyl-?

The predicted pKa value is 12.02±0.40.

What is the CAS number of 8-methoxyflindersine?

The CAS number is 35989-00-5.

※ Please kindly note that our products are for research use only.