Methscopolamine nitrate

Catalog Number	ACM6106463-1
CAS Number	6106-46-3
Structure
Synonyms	Hyoscine methonitrate
Molecular Weight	380.4
InChI	InChI=1S/C18H24NO4.NO3/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11;2-1(3)4/h3-7,12-17,20H,8-10H2,1-2H3;/q+1;-1/t12?,13-,14-,15+,16-,17+;/m1./s1
InChI Key	BSQIVYOSLFLSGE-OZVSTBQFSA-N
Melting Point	199 °C
Purity	98%+
Complexity	472
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	5
Exact Mass	380.15835111
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[N+]1([C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)C4=CC=CC=C4)C.[N+](=O)([O-])[O-]
Monoisotopic Mass	380.15835111
PhysicalState	Solid
Rotatable Bond Count	5
Topological Polar Surface Area	122 Ų

Custom Q&A

What is the chemical name for the compound Methscopolamine nitrate?

The chemical name for the compound Methscopolamine nitrate is SCOPOLAMINE METHYL NITRATE.

What is the CAS number for Methscopolamine nitrate?

The CAS number for Methscopolamine nitrate is 6106-46-3.

What is the molecular formula of Methscopolamine nitrate?

The molecular formula of Methscopolamine nitrate is C18H24N2O7.

What is the safety classification of Methscopolamine nitrate according to the Hazard Codes?

The Hazard Codes indicate that Methscopolamine nitrate is classified as T and T+.

What is the primary usage of Methscopolamine nitrate?

Methscopolamine nitrate is primarily used as a competitive antimuscarinic agent.

Which company initially developed Methscopolamine nitrate?

Methscopolamine nitrate was originated by Transderm, Scop Novartis Consumer Health Inc.

What is the therapeutic function of Methscopolamine nitrate?

The therapeutic function of Methscopolamine nitrate is as an anticholinergic and spasmolytic.

How is Methscopolamine nitrate manufactured from scopolamine hydrobromide trihydrate?

Methscopolamine nitrate is manufactured from scopolamine hydrobromide trihydrate by first dissolving it in water, adding sodium hydroxide, extracting with ether, reacting with methyl bromide, and recrystallizing the product.

What is the water solubility of Methscopolamine nitrate?

Methscopolamine nitrate is almost transparent in water.

What is the melting point of Methscopolamine nitrate?

The melting point of Methscopolamine nitrate is 199 °C.

※ Please kindly note that our products are for research use only.