Methyl 3-carbazolecarboxylate

Catalog Number	ACM97931414
CAS Number	97931-41-4
Structure
Synonyms	3-Methoxycarbonylcarbazole
IUPAC Name	Methyl 9H-carbazole-3-carboxylate
Molecular Weight	225.24
Molecular Formula	C14H11NO2
Canonical SMILES	COC(=O)C1=CC2=C(C=C1)NC3=CC=CC=C32
InChI	InChI=1S/C14H11NO2/c1-17-14(16)9-6-7-13-11(8-9)10-4-2-3-5-12(10)15-13/h2-8,15H,1H3
InChI Key	LZXXHWWSVRIDGR-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	305
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	225.078978594
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	225.078978594
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	42.1 Ų

Custom Q&A

What is the chemical formula of Methyl 3-carbazolecarboxylate?

The chemical formula of Methyl 3-carbazolecarboxylate is C14H11NO2.

What is the molecular weight of Methyl 3-carbazolecarboxylate?

The molecular weight of Methyl 3-carbazolecarboxylate is 225.24.

What is the CAS number of Methyl 3-carbazolecarboxylate?

The CAS number of Methyl 3-carbazolecarboxylate is 97931-41-4.

What is the melting point of Methyl 3-carbazolecarboxylate?

The melting point of Methyl 3-carbazolecarboxylate is 183-185 °C.

What is the predicted boiling point of Methyl 3-carbazolecarboxylate?

The predicted boiling point of Methyl 3-carbazolecarboxylate is 421.1±18.0 °C.

Where should Methyl 3-carbazolecarboxylate be stored?

Methyl 3-carbazolecarboxylate should be stored at 2-8°C.

What is the pka value of Methyl 3-carbazolecarboxylate?

The pka value of Methyl 3-carbazolecarboxylate is 16.00±0.30.

What is the usage of Methyl 3-carbazolecarboxylate?

Methyl 3-carbazolecarboxylate is used as a member of carbazoles.

What are some synonyms for Methyl 3-carbazolecarboxylate?

Some synonyms for Methyl 3-carbazolecarboxylate include 3-methoxycarbonylcarbazole, Methyl 9H-carbazole-3-carboxylate, and Methyl carbazole-3-carboxylate.

Why is Methyl 3-carbazolecarboxylate important in the field of chemistry?

Methyl 3-carbazolecarboxylate is important in the field of chemistry because it is a compound that can be used in various synthesis and research processes related to carbazoles.

※ Please kindly note that our products are for research use only.