Methyl 4-methoxy-9H-pyrido[3,4-b]indole-1-carboxylate

Catalog Number	ACM60807252-1
CAS Number	60807-25-2
Synonyms	4-Methoxy-1-methoxycarbonyl-beta-carboline
Molecular Weight	256.26
InChI	InChI=1S/C14H12N2O3/c1-18-10-7-15-13(14(17)19-2)12-11(10)8-5-3-4-6-9(8)16-12/h3-7,16H,1-2H3
InChI Key	WNNUGSXDGKSRRG-UHFFFAOYSA-N
Purity	95%+
Complexity	350
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	256.08479225
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	256.08479225
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	64.2 Ų

Custom Q&A

What is another name for Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

4-Methoxy-1-Methoxycarbonyl-beta-carboline

What are some synonyms for Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

4-methoxy-beta-carboline-1-carboxylic acid methyl ester, 4-Methoxy-1-Methoxycarbonyl-β-carboline, 4-Methoxy-β-carboline-1-carboxylic acid methylester

What is the CAS number for Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

60807-25-2

What is the molecular formula of Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

C14H12N2O3

What is the molecular weight of Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

256.26

What is the storage temperature recommendation for Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

2-8°C

How many carbon atoms are present in the molecular formula of Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

14

What functional groups are present in the chemical structure of Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate?

Methoxy, carbonyl, indole

What is the full name of the chemical compound with the abbreviation MF?

Molecular Formula

Why is it important to store Methyl 4-Methoxy-9H-pyrido[3,4-b]indole-1-carboxylate at a temperature of 2-8°C?

To maintain its stability and prevent degradation.

※ Please kindly note that our products are for research use only.