9-Methyl-9H-beta-carboline

Catalog Number	ACM2521075-1
CAS Number	2521-07-5
Structure
Synonyms	9-Methyl-9H-pyrido(3,4-b)indole
IUPAC Name	9-Methylpyrido[3,4-b]indole
Molecular Weight	182.20
Molecular Formula	C12H10N2
Canonical SMILES	CN1C2=CC=CC=C2C3=C1C=NC=C3
InChI	InChI=1S/C12H10N2/c1-14-11-5-3-2-4-9(11)10-6-7-13-8-12(10)14/h2-8H,1H3
InChI Key	MABOIYXDALNSES-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	216
Exact Mass	182.084398327
Heavy Atom Count	14
Monoisotopic Mass	182.084398327
Topological Polar Surface Area	17.8Ų

Custom Q&A

What is the chemical formula for 9-Methyl-9H-beta-carboline?

The chemical formula for 9-Methyl-9H-beta-carboline is C12H10N2.

What is the molecular weight of 9-Methyl-9H-beta-carboline?

The molecular weight of 9-Methyl-9H-beta-carboline is 182.22.

What is the melting point of 9-Methyl-9H-beta-carboline?

The melting point of 9-Methyl-9H-beta-carboline is 105.0 to 109.0 °C.

What is the boiling point of 9-Methyl-9H-beta-carboline?

The boiling point of 9-Methyl-9H-beta-carboline is 367.3±24.0 °C.

What is the solubility of 9-Methyl-9H-beta-carboline in different solvents?

9-Methyl-9H-beta-carboline is soluble in DMF (20 mg/ml), DMSO (20 mg/ml), and DMSO:PBS (pH 7.2) (1:3) (0.33 mg/ml).

What color does 9-Methyl-9H-beta-carboline appear in?

9-Methyl-9H-beta-carboline can appear as white, yellow, or green in color.

What is the usage of 9-Methyl-9H-beta-carboline?

9-Methyl-9H-beta-carboline is used as an analytical reference standard categorized as a nootropic.

How does 9-Methyl-9H-beta-carboline improve spatial learning in rats?

9-Methyl-9H-beta-carboline improves spatial learning in rats by acting as a nootropic.

How is 9-Methyl-9H-beta-carboline prepared?

9-Methyl-9H-beta-carboline can be prepared by performing the Eschweiler-Clarke reaction on freebase β-carboline (norharmane).

For what purposes is 9-Methyl-9H-beta-carboline intended?

9-Methyl-9H-beta-carboline is intended for research and forensic applications.

※ Please kindly note that our products are for research use only.