Methyl chanofruticosinate

Catalog Number	ACM14050921
CAS Number	14050-92-1
Synonyms	Pistiline methyl ester
Molecular Weight	410.5
InChI	InChI=1S/C23H26N2O5/c1-29-19(27)22-10-9-21-8-5-11-24-13-15(17(26)12-21)23(22,18(21)24)14-6-3-4-7-16(14)25(22)20(28)30-2/h3-4,6-7,15,18H,5,8-13H2,1-2H3/t15-,18+,21-,22-,23+/m1/s1
InChI Key	WLIDZKOEMWHMRI-UYUNAAPYSA-N
Purity	95%+
Complexity	830
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	410.18417193
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	0
Isomeric SMILES	COC(=O)[C@]12CC[C@@]34CCCN5[C@@H]3[C@@]1([C@H](C5)C(=O)C4)C6=CC=CC=C6N2C(=O)OC
Monoisotopic Mass	410.18417193
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	76.2 Ų

Custom Q&A

What is the chemical formula for Methyl chafruticosinate?

The chemical formula for Methyl chafruticosinate is C23H26N2O5.

What is the molecular weight of Methyl chafruticosinate?

The molecular weight of Methyl chafruticosinate is 410.47 g/mol.

What is the CAS number for Methyl chafruticosinate?

The CAS number for Methyl chafruticosinate is 14050-92-1.

What are some synonyms for Methyl chafruticosinate?

Some synonyms for Methyl chafruticosinate are Methyl chanofruticosinate, Pistiline methyl ester, and 11,21-Cycloaspidospermidine-1,2-dicarboxylic acid, 21-oxo-, 1,2-dimethyl ester, (2β)-.

What is the predicted boiling point of Methyl chafruticosinate?

The predicted boiling point of Methyl chafruticosinate is 558.5±50.0 °C.

What is the predicted density of Methyl chafruticosinate?

The predicted density of Methyl chafruticosinate is 1.40±0.1 g/cm3.

What is the predicted pKa value of Methyl chafruticosinate?

The predicted pKa value of Methyl chafruticosinate is 7.02±0.40.

What is the role of Methyl chafruticosinate in chemical processes?

Methyl chafruticosinate may be used as a reagent or intermediate in chemical reactions.

How does the chemical structure of Methyl chafruticosinate contribute to its properties?

The specific arrangement of atoms in the chemical structure of Methyl chafruticosinate determines its physical and chemical properties, such as boiling point, density, and pKa value.

※ Please kindly note that our products are for research use only.