1-Methyl-6,8-dimethoxyquinoline-2 1H-one

Catalog Number	ACM1210820679
CAS Number	1210820-67-9
IUPAC Name	6,8-Dimethoxy-1-methylquinolin-2-one
Molecular Weight	219.20
Molecular Formula	C12H13NO3
Canonical SMILES	CN1C(=O)C=CC2=CC(=CC(=C21)OC)OC
InChI	InChI=1S/C12H13NO3/c1-13-11(14)5-4-8-6-9(15-2)7-10(16-3)12(8)13/h4-7H,1-3H3
InChI Key	FDGHKOCQNFVTGP-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	303
Exact Mass	219.08954328
Heavy Atom Count	16
Monoisotopic Mass	219.08954328
Topological Polar Surface Area	38.8Ų

Custom Q&A

What is the product name of the compound with the CAS number 1210820-67-9?

The product name is 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone.

What are the synonyms for 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone?

The synonyms are 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone and 1-Methyl-6,8-dimethoxyquinoline-2 1H-one.

What is the molecular formula of 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone?

The molecular formula is C12H13NO3.

What is the molecular weight of 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone?

The molecular weight is 219.24 g/mol.

What is the boiling point of 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone?

The boiling point is predicted to be 367.1±42.0 °C.

What is the density of 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone at 20 °C and 760 Torr?

The density is predicted to be 1.184±0.06 g/cm3.

What is the pka value of 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone?

The pka value is predicted to be 2.22±0.20.

How many carbon atoms are present in the molecular formula of 6,8-Dimethoxy-1-methyl-2(1H)-quinolinone?

There are 12 carbon atoms present.

※ Please kindly note that our products are for research use only.