Methyl ibogamine-18-carboxylate

Methyl ibogamine-18-carboxylate

Inquiry
Catalog Number ACM467776
CAS Number 467-77-6
Structure
Synonyms Coronardine
Molecular Weight 338.4
InChI InChI=1S/C21H26N2O2/c1-3-14-10-13-11-21(20(24)25-2)18-16(8-9-23(12-13)19(14)21)15-6-4-5-7-17(15)22-18/h4-7,13-14,19,22H,3,8-12H2,1-2H3/t13-,14+,19+,21-/m1/s1
InChI Key NVVDQMVGALBDGE-PZXGUROGSA-N
Purity 90%+
Complexity 552
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 338.199428076
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 1
Isomeric SMILES CC[C@H]1C[C@@H]2C[C@@]3([C@H]1N(C2)CCC4=C3NC5=CC=CC=C45)C(=O)OC
Monoisotopic Mass 338.199428076
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 45.3 Ų
Custom Q&A

What is the chemical name of the compound referred to as methyl ibogamine-18-carboxylate?

The chemical name of the compound is Ibogamine-18-carboxylic Acid Methyl Ester.

What is the CAS number for methyl ibogamine-18-carboxylate?

The CAS number is 467-77-6.

What is the molecular formula of methyl ibogamine-18-carboxylate?

The molecular formula is C21H26N2O2.

What is the melting point of methyl ibogamine-18-carboxylate?

The melting point is 92-93 °C.

What is the boiling point of methyl ibogamine-18-carboxylate?

The predicted boiling point is 488.1±45.0 °C.

What is the storage temperature recommended for methyl ibogamine-18-carboxylate?

The recommended storage temperature is 4°C, protect from light.

What is the biological activity of coronaridine, a compound related to methyl ibogamine-18-carboxylate?

Coronaridine inhibits the wnt signaling pathway by decreasing β-catenin expression.

What are the uses of Ibogamine-18-carboxylic Acid Methyl Ester in research?

It is used in the biosynthesis of anti-addiction agent from the iboga plant.

What role does coronaridine have as a compound?

It has a role as an antileishmanial agent, an antineoplastic agent, an apoptosis inducer, and a plant metabolite.

What is the pKa value of methyl ibogamine-18-carboxylate?

The pKa value is predicted to be 16±0.60.

※ Please kindly note that our products are for research use only.