Methyl phaeophorbide

Methyl phaeophorbide

Inquiry
Catalog Number ACM5594309-1
CAS Number 5594-30-9
Synonyms Demagnesia chloric acid -a methyl ester
Molecular Weight 606.7
InChI InChI=1S/C36H38N4O5/c1-9-20-16(3)23-13-25-18(5)22(11-12-29(41)44-7)33(39-25)31-32(36(43)45-8)35(42)30-19(6)26(40-34(30)31)15-28-21(10-2)17(4)24(38-28)14-27(20)37-23/h9,13-15,18,22,32,39,42H,1,10-12H2,2-8H3
InChI Key HUXSMOZWPXDRTN-UHFFFAOYSA-N
Melting Point 226-228 °C
Purity 95%+
Complexity 1830
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 606.28422033
Heavy Atom Count 45
Hydrogen Bond Acceptor Count 9
Hydrogen Bond Donor Count 2
Monoisotopic Mass 606.28422033
PhysicalState Powder
Rotatable Bond Count 8
Topological Polar Surface Area 122 Ų
Custom Q&A

What is the chemical formula of methyl phaeophorbide?

The chemical formula of methyl phaeophorbide is C36H38N4O5.

What is the molecular weight of methyl phaeophorbide?

The molecular weight of methyl phaeophorbide is 606.71 g/mol.

What is the CAS number of methyl phaeophorbide?

The CAS number of methyl phaeophorbide is 5594-30-9.

What is the melting point of methyl phaeophorbide?

The melting point of methyl phaeophorbide is 226-228 °C.

What is the predicted boiling point of methyl phaeophorbide?

The predicted boiling point of methyl phaeophorbide is 956.2 ± 65.0 °C.

What is the predicted density of methyl phaeophorbide?

The predicted density of methyl phaeophorbide is 1.244 ± 0.06 g/cm3.

Can methyl phaeophorbide be referred to as Chlorophyll Impurity 1?

Yes, methyl phaeophorbide can also be referred to as Chlorophyll Impurity 1.

What are some other synonyms for methyl phaeophorbide?

Some other synonyms for methyl phaeophorbide are Methylpheophorbide, PHEOPHORBIDEAMETHYLESTER, and Methyl pheophorbide a.

What is the EINECS number of methyl phaeophorbide?

The EINECS number of methyl phaeophorbide is 227-007-3.

What is the structural configuration of methyl phaeophorbide?

The structural configuration of methyl phaeophorbide is [3S-(3alpha,4beta,21beta]-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinylphorbine-3-propionate.

※ Please kindly note that our products are for research use only.