Microgrewiapine A

Catalog Number	ACM1420777305
CAS Number	1420777-30-5
Molecular Weight	263.4
InChI	InChI=1S/C17H29NO/c1-4-5-6-7-8-9-10-11-12-16-13-14-17(19)15(2)18(16)3/h7-12,15-17,19H,4-6,13-14H2,1-3H3/b8-7+,10-9+,12-11+/t15,16,17-/m1/s1
InChI Key	ZBJGGLXQNXXXRO-CEQRNSKPSA-N
Purity	95%+
Complexity	319
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	263.224914549
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CCCC/C=C/C=C/C=C/C1CC[C@H](C(N1C)C)O
Monoisotopic Mass	263.224914549
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	23.5 Ų

Custom Q&A

What is the predicted pka value of Microgrewiapine A?

The predicted pka value of Microgrewiapine A is 14.80±0.60.

What are the synonyms for Microgrewiapine A?

The synonyms for Microgrewiapine A include 3-Piperidinol, 6-(1E,3E,5E)-1,3,5-decatrien-1-yl-1,2-dimethyl-, (2S,3R,6S)-.

What is the CAS number for Microgrewiapine A?

The CAS number for Microgrewiapine A is 1420777-30-5.

What is the molecular formula of Microgrewiapine A?

The molecular formula of Microgrewiapine A is C17H29NO.

What is the molecular weight of Microgrewiapine A?

The molecular weight of Microgrewiapine A is 263.42.

What is the predicted boiling point of Microgrewiapine A?

The predicted boiling point of Microgrewiapine A is 371.6±42.0 °C.

What is the predicted density of Microgrewiapine A?

The predicted density of Microgrewiapine A is 0.964±0.06 g/cm3.

※ Please kindly note that our products are for research use only.