N-Acetylcolchamine

Catalog Number	ACM7336405
CAS Number	7336-40-5
Structure
Synonyms	N-Methylcolchicine
Molecular Weight	413.5
InChI	InChI=1S/C23H27NO6/c1-13(25)24(2)17-9-7-14-11-20(28-4)22(29-5)23(30-6)21(14)15-8-10-19(27-3)18(26)12-16(15)17/h8,10-12,17H,7,9H2,1-6H3/t17-/m0/s1
InChI Key	AHZFWPXTSZCLDJ-KRWDZBQOSA-N
Purity	95%+
Complexity	770
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	413.18383758
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC(=O)N(C)[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC
Monoisotopic Mass	413.18383758
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	74.3 Ų

Custom Q&A

What is the product name for the chemical compound with the CAS number 7336-40-5?

Colchicine, N-methyl-

What are some synonyms for Colchicine, N-methyl-?

N-[(S)-5,6,7,9-Tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]-N-methylacetamide; N-Acetylcolchamine; N-Acetyldemecolcine; N-Methylcolchicine; Acetamide, N-methyl-N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]-; N-Acetaminophen; NSC 403155

What is the molecular formula of Colchicine, N-methyl-?

C23H27NO6

What is the molecular weight of Colchicine, N-methyl-?

413.46

What is the specific rotation of N-acetyldemecolcine?

-2440 (c 1.0, CHCl3)

From which plants is N-acetyldemecolcine extracted?

Colchicum autumnale, Gloriosa virescens, and Littoria modesta

How is N-acetyldemecolcine separated from other bases?

It is separated by column and thin-layer chromatography.

In what type of alkaloid category does N-acetyldemecolcine belong?

Colchicine type alkaloid

What is the source of the reference about N-acetyldemecolcine?

Potesilova, Hrbek, Santavy, Collect. Czech. Chem. Commun., 32, 141 (1967)

What is the CAS number for N-acetyldemecolcine?

7336-40-5

※ Please kindly note that our products are for research use only.