N-Benzoyltyramine

Catalog Number	ACM41859545
CAS Number	41859-54-5
Synonyms	N-(4-Hydroxyphenethyl)benzamide
IUPAC Name	N-[2-(4-Hydroxyphenyl)ethyl]benzamide
Molecular Weight	241.30
Molecular Formula	C15H15NO2
Canonical SMILES	C1=CC=C(C=C1)C(=O)NCCC2=CC=C(C=C2)O
InChI	InChI=1S/C15H15NO2/c17-14-8-6-12(7-9-14)10-11-16-15(18)13-4-2-1-3-5-13/h1-9,17H,10-11H2,(H,16,18)
InChI Key	MUCNBPCTSRYLCB-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	253
Exact Mass	241.110278721
Heavy Atom Count	18
Monoisotopic Mass	241.110278721
Topological Polar Surface Area	49.3Ų

Custom Q&A

What is the chemical name of N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The chemical name is N-Benzoyltyramine.

What are some synonyms for N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

Some synonyms include N-(4-Hydroxyphenethyl)benzamide and Benzamide, N-[2-(4-hydroxyphenyl)ethyl]-.

What is the CAS number for N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The CAS number is 41859-54-5.

What is the molecular formula for N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The molecular formula is C15H15NO2.

What is the molecular weight of N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The molecular weight is 241.29.

What is the melting point of N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The melting point is 162 °C.

What is the predicted boiling point of N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The predicted boiling point is 505.1±33.0 °C.

What is the predicted density of N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The predicted density is 1.174±0.06 g/cm3.

What is the predicted pka value of N-[2-(4-Hydroxyphenyl)ethyl]benzamide?

The predicted pka value is 10.01±0.15.

※ Please kindly note that our products are for research use only.